C52H55FN6 — CID 137420745
2-[3-[4,6-bis(4-tert-butylphenyl)-1,3,5-triazin-2-yl]-4-fluorophenyl]-4,6-bis(4-tert-butylphenyl)-1,3,5-triazine (PubChem CID 137420745) has the molecular formula C52H55FN6 and a molecular weight of 783.05 g/mol. Its IUPAC name is 2-[3-[4,6-bis(4-tert-butylphenyl)-1,3,5-triazin-2-yl]-4-fluorophenyl]-4,6-bis(4-tert-butylphenyl)-1,3,5-triazine.
| Compound Name | 2-[3-[4,6-bis(4-tert-butylphenyl)-1,3,5-triazin-2-yl]-4-fluorophenyl]-4,6-bis(4-tert-butylphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 137420745 |
| Molecular Formula | C52H55FN6 |
| Molecular Weight | 783.05 g/mol |
| Exact Mass | 782.45 |
| IUPAC Name | 2-[3-[4,6-bis(4-tert-butylphenyl)-1,3,5-triazin-2-yl]-4-fluorophenyl]-4,6-bis(4-tert-butylphenyl)-1,3,5-triazine |
| SMILES | CC(C)(C)c1ccc(-c2nc(-c3ccc(C(C)(C)C)cc3)nc(-c3ccc(F)c(-c4nc(-c5ccc(C(C)(C)C)cc5)nc(-c5ccc(C(C)(C)C)cc5)n4)c3)n2)cc1 |
| InChI | InChI=1S/C52H55FN6/c1-49(2,3)37-22-13-32(14-23-37)43-54-44(33-15-24-38(25-16-33)50(4,5)6)57-47(56-43)36-21-30-42(53)41(31-36)48-58-45(34-17-26-39(27-18-34)51(7,8)9)55-46(59-48)35-19-28-40(29-20-35)52(10,11)12/h13-31H,1-12H3 |
| InChIKey | OJINYHCGOJCLPD-UHFFFAOYSA-N |
| XLogP | 13.39 |
| TPSA | 77.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 783.05 |
| LogP ≤ 5 | 13.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |