About (3S,5S)-3,5-dimethyl-4-[1-[(3R)-3-methyl-4-propan-2-ylmorpholin-2-yl]propan-2-yl]morpholine
(3S,5S)-3,5-dimethyl-4-[1-[(3R)-3-methyl-4-propan-2-ylmorpholin-2-yl]propan-2-yl]morpholine (PubChem CID 137421883) has the molecular formula C17H34N2O2
and a molecular weight of 298.47 g/mol. Its IUPAC name is (3S,5S)-3,5-dimethyl-4-[1-[(3R)-3-methyl-4-propan-2-ylmorpholin-2-yl]propan-2-yl]morpholine.
Molecular Properties
| Compound Name | (3S,5S)-3,5-dimethyl-4-[1-[(3R)-3-methyl-4-propan-2-ylmorpholin-2-yl]propan-2-yl]morpholine |
| PubChem CID | 137421883 |
| Molecular Formula | C17H34N2O2 |
| Molecular Weight | 298.47 g/mol |
| Exact Mass | 298.26 |
| IUPAC Name | (3S,5S)-3,5-dimethyl-4-[1-[(3R)-3-methyl-4-propan-2-ylmorpholin-2-yl]propan-2-yl]morpholine |
| SMILES | CC(C)N1CCOC(CC(C)N2[C@@H](C)COC[C@@H]2C)[C@H]1C |
| InChI | InChI=1S/C17H34N2O2/c1-12(2)18-7-8-21-17(16(18)6)9-13(3)19-14(4)10-20-11-15(19)5/h12-17H,7-11H2,1-6H3/t13?,14-,15-,16+,17?/m0/s1 |
| InChIKey | HSXADHMZVAMJRH-LHJGCZIBSA-N |
| XLogP | 2.37 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.47 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3S,5S)-3,5-dimethyl-4-[1-[(3R)-3-methyl-4-propan-2-ylmorpholin-2-yl]propan-2-yl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,5S)-3,5-dimethyl-4-[1-[(3R)-3-methyl-4-propan-2-ylmorpholin-2-yl]propan-2-yl]morpholine?
The IUPAC name of (3S,5S)-3,5-dimethyl-4-[1-[(3R)-3-methyl-4-propan-2-ylmorpholin-2-yl]propan-2-yl]morpholine (CID 137421883) is (3S,5S)-3,5-dimethyl-4-[1-[(3R)-3-methyl-4-propan-2-ylmorpholin-2-yl]propan-2-yl]morpholine.
What is the SMILES notation for (3S,5S)-3,5-dimethyl-4-[1-[(3R)-3-methyl-4-propan-2-ylmorpholin-2-yl]propan-2-yl]morpholine?
The canonical SMILES for (3S,5S)-3,5-dimethyl-4-[1-[(3R)-3-methyl-4-propan-2-ylmorpholin-2-yl]propan-2-yl]morpholine is CC(C)N1CCOC(CC(C)N2[C@@H](C)COC[C@@H]2C)[C@H]1C.
What is the InChIKey of (3S,5S)-3,5-dimethyl-4-[1-[(3R)-3-methyl-4-propan-2-ylmorpholin-2-yl]propan-2-yl]morpholine?
The InChIKey is HSXADHMZVAMJRH-LHJGCZIBSA-N. The full InChI is InChI=1S/C17H34N2O2/c1-12(2)18-7-8-21-17(16(18)6)9-13(3)19-14(4)10-20-11-15(19)5/h12-17H,7-11H2,1-6H3/t13?,14-,15-,16+,17?/m0/s1.
What are the key properties of (3S,5S)-3,5-dimethyl-4-[1-[(3R)-3-methyl-4-propan-2-ylmorpholin-2-yl]propan-2-yl]morpholine?
(3S,5S)-3,5-dimethyl-4-[1-[(3R)-3-methyl-4-propan-2-ylmorpholin-2-yl]propan-2-yl]morpholine has a molecular weight of 298.47 g/mol, XLogP of 2.37, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,5S)-3,5-dimethyl-4-[1-[(3R)-3-methyl-4-propan-2-ylmorpholin-2-yl]propan-2-yl]morpholine is sourced from PubChem (CID 137421883), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).