About trans-fluoro (1R,2S)-2-ethenyl-1-(4-nitrophenyl)sulfonylcyclopropane-1-carboxylate
trans-fluoro (1R,2S)-2-ethenyl-1-(4-nitrophenyl)sulfonylcyclopropane-1-carboxylate (PubChem CID 137422036) has the molecular formula C12H10FNO6S
and a molecular weight of 315.28 g/mol. Its IUPAC name is trans-fluoro (1R,2S)-2-ethenyl-1-(4-nitrophenyl)sulfonylcyclopropane-1-carboxylate.
Molecular Properties
| Compound Name | trans-fluoro (1R,2S)-2-ethenyl-1-(4-nitrophenyl)sulfonylcyclopropane-1-carboxylate |
| PubChem CID | 137422036 |
| Molecular Formula | C12H10FNO6S |
| Molecular Weight | 315.28 g/mol |
| Exact Mass | 315.02 |
| IUPAC Name | trans-fluoro (1R,2S)-2-ethenyl-1-(4-nitrophenyl)sulfonylcyclopropane-1-carboxylate |
| SMILES | C=C[C@@H]1C[C@@]1(C(=O)OF)S(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C12H10FNO6S/c1-2-8-7-12(8,11(15)20-13)21(18,19)10-5-3-9(4-6-10)14(16)17/h2-6,8H,1,7H2/t8-,12-/m1/s1 |
| InChIKey | RQQHBXLJPPMHCS-PRHODGIISA-N |
| XLogP | 1.74 |
| TPSA | 103.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.28 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze trans-fluoro (1R,2S)-2-ethenyl-1-(4-nitrophenyl)sulfonylcyclopropane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-fluoro (1R,2S)-2-ethenyl-1-(4-nitrophenyl)sulfonylcyclopropane-1-carboxylate?
The IUPAC name of trans-fluoro (1R,2S)-2-ethenyl-1-(4-nitrophenyl)sulfonylcyclopropane-1-carboxylate (CID 137422036) is trans-fluoro (1R,2S)-2-ethenyl-1-(4-nitrophenyl)sulfonylcyclopropane-1-carboxylate.
What is the SMILES notation for trans-fluoro (1R,2S)-2-ethenyl-1-(4-nitrophenyl)sulfonylcyclopropane-1-carboxylate?
The canonical SMILES for trans-fluoro (1R,2S)-2-ethenyl-1-(4-nitrophenyl)sulfonylcyclopropane-1-carboxylate is C=C[C@@H]1C[C@@]1(C(=O)OF)S(=O)(=O)c1ccc([N+](=O)[O-])cc1.
What is the InChIKey of trans-fluoro (1R,2S)-2-ethenyl-1-(4-nitrophenyl)sulfonylcyclopropane-1-carboxylate?
The InChIKey is RQQHBXLJPPMHCS-PRHODGIISA-N. The full InChI is InChI=1S/C12H10FNO6S/c1-2-8-7-12(8,11(15)20-13)21(18,19)10-5-3-9(4-6-10)14(16)17/h2-6,8H,1,7H2/t8-,12-/m1/s1.
What are the key properties of trans-fluoro (1R,2S)-2-ethenyl-1-(4-nitrophenyl)sulfonylcyclopropane-1-carboxylate?
trans-fluoro (1R,2S)-2-ethenyl-1-(4-nitrophenyl)sulfonylcyclopropane-1-carboxylate has a molecular weight of 315.28 g/mol, XLogP of 1.74, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for trans-fluoro (1R,2S)-2-ethenyl-1-(4-nitrophenyl)sulfonylcyclopropane-1-carboxylate is sourced from PubChem (CID 137422036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).