C5HF7 — CID 137422612
(3E)-1,1,2,3,4,5,5-heptafluoropenta-1,3-diene (PubChem CID 137422612) has the molecular formula C5HF7 and a molecular weight of 194.05 g/mol. Its IUPAC name is (3E)-1,1,2,3,4,5,5-heptafluoropenta-1,3-diene.
| Compound Name | (3E)-1,1,2,3,4,5,5-heptafluoropenta-1,3-diene |
|---|---|
| PubChem CID | 137422612 |
| Molecular Formula | C5HF7 |
| Molecular Weight | 194.05 g/mol |
| Exact Mass | 194.00 |
| IUPAC Name | (3E)-1,1,2,3,4,5,5-heptafluoropenta-1,3-diene |
| SMILES | FC(F)=C(F)/C(F)=C(\F)C(F)F |
| InChI | InChI=1S/C5HF7/c6-1(2(7)4(9)10)3(8)5(11)12/h4H/b2-1+ |
| InChIKey | DZSLZHCSIXOHBE-OWOJBTEDSA-N |
| XLogP | 3.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.05 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|