About 6-isoquinolin-6-yl-7-phenyl-1H-1,8-naphthyridin-4-one
6-isoquinolin-6-yl-7-phenyl-1H-1,8-naphthyridin-4-one (PubChem CID 137423274) has the molecular formula C23H15N3O
and a molecular weight of 349.39 g/mol. Its IUPAC name is 6-isoquinolin-6-yl-7-phenyl-1H-1,8-naphthyridin-4-one.
Molecular Properties
| Compound Name | 6-isoquinolin-6-yl-7-phenyl-1H-1,8-naphthyridin-4-one |
| PubChem CID | 137423274 |
| Molecular Formula | C23H15N3O |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | 6-isoquinolin-6-yl-7-phenyl-1H-1,8-naphthyridin-4-one |
| SMILES | O=c1cc[nH]c2nc(-c3ccccc3)c(-c3ccc4cnccc4c3)cc12 |
| InChI | InChI=1S/C23H15N3O/c27-21-9-11-25-23-20(21)13-19(22(26-23)15-4-2-1-3-5-15)17-6-7-18-14-24-10-8-16(18)12-17/h1-14H,(H,25,26,27) |
| InChIKey | FHXCLJGTLCCPFB-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-isoquinolin-6-yl-7-phenyl-1H-1,8-naphthyridin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-isoquinolin-6-yl-7-phenyl-1H-1,8-naphthyridin-4-one?
The IUPAC name of 6-isoquinolin-6-yl-7-phenyl-1H-1,8-naphthyridin-4-one (CID 137423274) is 6-isoquinolin-6-yl-7-phenyl-1H-1,8-naphthyridin-4-one.
What is the SMILES notation for 6-isoquinolin-6-yl-7-phenyl-1H-1,8-naphthyridin-4-one?
The canonical SMILES for 6-isoquinolin-6-yl-7-phenyl-1H-1,8-naphthyridin-4-one is O=c1cc[nH]c2nc(-c3ccccc3)c(-c3ccc4cnccc4c3)cc12.
What is the InChIKey of 6-isoquinolin-6-yl-7-phenyl-1H-1,8-naphthyridin-4-one?
The InChIKey is FHXCLJGTLCCPFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H15N3O/c27-21-9-11-25-23-20(21)13-19(22(26-23)15-4-2-1-3-5-15)17-6-7-18-14-24-10-8-16(18)12-17/h1-14H,(H,25,26,27).
What are the key properties of 6-isoquinolin-6-yl-7-phenyl-1H-1,8-naphthyridin-4-one?
6-isoquinolin-6-yl-7-phenyl-1H-1,8-naphthyridin-4-one has a molecular weight of 349.39 g/mol, XLogP of 4.81, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-isoquinolin-6-yl-7-phenyl-1H-1,8-naphthyridin-4-one is sourced from PubChem (CID 137423274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).