C20H20ClF5N2OS — CID 137423320
(Z)-1-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]-3-[3-(pentafluoro-λ6-sulfanyl)phenyl]prop-2-en-1-one (PubChem CID 137423320) has the molecular formula C20H20ClF5N2OS and a molecular weight of 466.90 g/mol. Its IUPAC name is (Z)-1-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]-3-[3-(pentafluoro-λ6-sulfanyl)phenyl]prop-2-en-1-one.
| Compound Name | (Z)-1-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]-3-[3-(pentafluoro-λ6-sulfanyl)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 137423320 |
| Molecular Formula | C20H20ClF5N2OS |
| Molecular Weight | 466.90 g/mol |
| Exact Mass | 466.09 |
| IUPAC Name | (Z)-1-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]-3-[3-(pentafluoro-λ6-sulfanyl)phenyl]prop-2-en-1-one |
| SMILES | Cc1ccc(Cl)cc1N1CCN(C(=O)/C=C\c2cccc(S(F)(F)(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C20H20ClF5N2OS/c1-15-5-7-17(21)14-19(15)27-9-11-28(12-10-27)20(29)8-6-16-3-2-4-18(13-16)30(22,23,24,25)26/h2-8,13-14H,9-12H2,1H3/b8-6- |
| InChIKey | GBBUOZANCNJWAN-VURMDHGXSA-N |
| XLogP | 6.67 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.90 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|