C54H60Cl2F2N6O2 — CID 137423581
(2S)-1,2-bis(4-chlorophenyl)-N,N'-bis[[1-[2-(2-fluorophenoxy)ethyl]piperidin-4-yl]methyl]-N,N'-dimethyl-1,2-dipyridin-2-ylethane-1,2-diamine (PubChem CID 137423581) has the molecular formula C54H60Cl2F2N6O2 and a molecular weight of 934.02 g/mol. Its IUPAC name is (2S)-1,2-bis(4-chlorophenyl)-N,N'-bis[[1-[2-(2-fluorophenoxy)ethyl]piperidin-4-yl]methyl]-N,N'-dimethyl-1,2-dipyridin-2-ylethane-1,2-diamine.
| Compound Name | (2S)-1,2-bis(4-chlorophenyl)-N,N'-bis[[1-[2-(2-fluorophenoxy)ethyl]piperidin-4-yl]methyl]-N,N'-dimethyl-1,2-dipyridin-2-ylethane-1,2-diamine |
|---|---|
| PubChem CID | 137423581 |
| Molecular Formula | C54H60Cl2F2N6O2 |
| Molecular Weight | 934.02 g/mol |
| Exact Mass | 932.41 |
| IUPAC Name | (2S)-1,2-bis(4-chlorophenyl)-N,N'-bis[[1-[2-(2-fluorophenoxy)ethyl]piperidin-4-yl]methyl]-N,N'-dimethyl-1,2-dipyridin-2-ylethane-1,2-diamine |
| SMILES | CN(CC1CCN(CCOc2ccccc2F)CC1)C(c1ccc(Cl)cc1)(c1ccccn1)[C@](c1ccc(Cl)cc1)(c1ccccn1)N(C)CC1CCN(CCOc2ccccc2F)CC1 |
| InChI | InChI=1S/C54H60Cl2F2N6O2/c1-61(39-41-25-31-63(32-26-41)35-37-65-49-13-5-3-11-47(49)57)53(51-15-7-9-29-59-51,43-17-21-45(55)22-18-43)54(52-16-8-10-30-60-52,44-19-23-46(56)24-20-44)62(2)40-42-27-33-64(34-28-42)36-38-66-50-14-6-4-12-48(50)58/h3-24,29-30,41-42H,25-28,31-40H2,1-2H3/t53-,54?/m0/s1 |
| InChIKey | KGVWLUQAMMBLBG-AVRFZLNTSA-N |
| XLogP | 10.69 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 934.02 |
| LogP ≤ 5 | 10.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |