C56H66F2N6O4 — CID 137423595
(2S)-N,N'-bis[[1-[2-(2-fluorophenoxy)ethyl]piperidin-4-yl]methyl]-1,2-bis(3-methoxyphenyl)-N,N'-dimethyl-1,2-dipyridin-2-ylethane-1,2-diamine (PubChem CID 137423595) has the molecular formula C56H66F2N6O4 and a molecular weight of 925.18 g/mol. Its IUPAC name is (2S)-N,N'-bis[[1-[2-(2-fluorophenoxy)ethyl]piperidin-4-yl]methyl]-1,2-bis(3-methoxyphenyl)-N,N'-dimethyl-1,2-dipyridin-2-ylethane-1,2-diamine.
| Compound Name | (2S)-N,N'-bis[[1-[2-(2-fluorophenoxy)ethyl]piperidin-4-yl]methyl]-1,2-bis(3-methoxyphenyl)-N,N'-dimethyl-1,2-dipyridin-2-ylethane-1,2-diamine |
|---|---|
| PubChem CID | 137423595 |
| Molecular Formula | C56H66F2N6O4 |
| Molecular Weight | 925.18 g/mol |
| Exact Mass | 924.51 |
| IUPAC Name | (2S)-N,N'-bis[[1-[2-(2-fluorophenoxy)ethyl]piperidin-4-yl]methyl]-1,2-bis(3-methoxyphenyl)-N,N'-dimethyl-1,2-dipyridin-2-ylethane-1,2-diamine |
| SMILES | COc1cccc(C(c2ccccn2)(N(C)CC2CCN(CCOc3ccccc3F)CC2)[C@](c2cccc(OC)c2)(c2ccccn2)N(C)CC2CCN(CCOc3ccccc3F)CC2)c1 |
| InChI | InChI=1S/C56H66F2N6O4/c1-61(41-43-25-31-63(32-26-43)35-37-67-51-21-7-5-19-49(51)57)55(53-23-9-11-29-59-53,45-15-13-17-47(39-45)65-3)56(54-24-10-12-30-60-54,46-16-14-18-48(40-46)66-4)62(2)42-44-27-33-64(34-28-44)36-38-68-52-22-8-6-20-50(52)58/h5-24,29-30,39-40,43-44H,25-28,31-38,41-42H2,1-4H3/t55-,56?/m0/s1 |
| InChIKey | PWIJZBFYFCYFDE-OWDRBVLISA-N |
| XLogP | 9.40 |
| TPSA | 75.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 925.18 |
| LogP ≤ 5 | 9.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |