C52H54Cl2F4N6O2 — CID 137423662
(2R)-1,2-bis(4-chlorophenyl)-N,N'-bis[[1-[2-(2,5-difluorophenoxy)ethyl]piperidin-4-yl]methyl]-1,2-dipyridin-2-ylethane-1,2-diamine (PubChem CID 137423662) has the molecular formula C52H54Cl2F4N6O2 and a molecular weight of 941.94 g/mol. Its IUPAC name is (2R)-1,2-bis(4-chlorophenyl)-N,N'-bis[[1-[2-(2,5-difluorophenoxy)ethyl]piperidin-4-yl]methyl]-1,2-dipyridin-2-ylethane-1,2-diamine.
| Compound Name | (2R)-1,2-bis(4-chlorophenyl)-N,N'-bis[[1-[2-(2,5-difluorophenoxy)ethyl]piperidin-4-yl]methyl]-1,2-dipyridin-2-ylethane-1,2-diamine |
|---|---|
| PubChem CID | 137423662 |
| Molecular Formula | C52H54Cl2F4N6O2 |
| Molecular Weight | 941.94 g/mol |
| Exact Mass | 940.36 |
| IUPAC Name | (2R)-1,2-bis(4-chlorophenyl)-N,N'-bis[[1-[2-(2,5-difluorophenoxy)ethyl]piperidin-4-yl]methyl]-1,2-dipyridin-2-ylethane-1,2-diamine |
| SMILES | Fc1ccc(F)c(OCCN2CCC(CNC(c3ccc(Cl)cc3)(c3ccccn3)[C@](NCC3CCN(CCOc4cc(F)ccc4F)CC3)(c3ccc(Cl)cc3)c3ccccn3)CC2)c1 |
| InChI | InChI=1S/C52H54Cl2F4N6O2/c53-41-11-7-39(8-12-41)51(49-5-1-3-23-59-49,61-35-37-19-25-63(26-20-37)29-31-65-47-33-43(55)15-17-45(47)57)52(50-6-2-4-24-60-50,40-9-13-42(54)14-10-40)62-36-38-21-27-64(28-22-38)30-32-66-48-34-44(56)16-18-46(48)58/h1-18,23-24,33-34,37-38,61-62H,19-22,25-32,35-36H2/t51-,52?/m0/s1 |
| InChIKey | ICQVYAGIYBSSIJ-QTWMKJDISA-N |
| XLogP | 10.29 |
| TPSA | 74.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 941.94 |
| LogP ≤ 5 | 10.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |