C54H56F6N6O4 — CID 137423739
1-(2-phenoxyethyl)-N-[pyridin-2-yl-[4-(trifluoromethyl)phenyl]methyl]piperidine-4-carboxamide (PubChem CID 137423739) has the molecular formula C54H56F6N6O4 and a molecular weight of 967.07 g/mol. Its IUPAC name is 1-(2-phenoxyethyl)-N-[pyridin-2-yl-[4-(trifluoromethyl)phenyl]methyl]piperidine-4-carboxamide.
| Compound Name | 1-(2-phenoxyethyl)-N-[pyridin-2-yl-[4-(trifluoromethyl)phenyl]methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 137423739 |
| Molecular Formula | C54H56F6N6O4 |
| Molecular Weight | 967.07 g/mol |
| Exact Mass | 966.43 |
| IUPAC Name | 1-(2-phenoxyethyl)-N-[pyridin-2-yl-[4-(trifluoromethyl)phenyl]methyl]piperidine-4-carboxamide |
| SMILES | O=C(NC(c1ccc(C(F)(F)F)cc1)c1ccccn1)C1CCN(CCOc2ccccc2)CC1.O=C(NC(c1ccc(C(F)(F)F)cc1)c1ccccn1)C1CCN(CCOc2ccccc2)CC1 |
| InChI | InChI=1S/2C27H28F3N3O2/c2*28-27(29,30)22-11-9-20(10-12-22)25(24-8-4-5-15-31-24)32-26(34)21-13-16-33(17-14-21)18-19-35-23-6-2-1-3-7-23/h2*1-12,15,21,25H,13-14,16-19H2,(H,32,34) |
| InChIKey | COZUSFNOZUQLFL-UHFFFAOYSA-N |
| XLogP | 10.19 |
| TPSA | 108.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 967.07 |
| LogP ≤ 5 | 10.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |