About 5-butan-2-yl-3,4-dihydro-2H-1,4-benzoxazine
5-butan-2-yl-3,4-dihydro-2H-1,4-benzoxazine (PubChem CID 137426093) has the molecular formula C12H17NO
and a molecular weight of 191.27 g/mol. Its IUPAC name is 5-butan-2-yl-3,4-dihydro-2H-1,4-benzoxazine.
Molecular Properties
| Compound Name | 5-butan-2-yl-3,4-dihydro-2H-1,4-benzoxazine |
| PubChem CID | 137426093 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | 5-butan-2-yl-3,4-dihydro-2H-1,4-benzoxazine |
| SMILES | CCC(C)c1cccc2c1NCCO2 |
| InChI | InChI=1S/C12H17NO/c1-3-9(2)10-5-4-6-11-12(10)13-7-8-14-11/h4-6,9,13H,3,7-8H2,1-2H3 |
| InChIKey | XDBZRYKHVSYGJW-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-butan-2-yl-3,4-dihydro-2H-1,4-benzoxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-butan-2-yl-3,4-dihydro-2H-1,4-benzoxazine?
The IUPAC name of 5-butan-2-yl-3,4-dihydro-2H-1,4-benzoxazine (CID 137426093) is 5-butan-2-yl-3,4-dihydro-2H-1,4-benzoxazine.
What is the SMILES notation for 5-butan-2-yl-3,4-dihydro-2H-1,4-benzoxazine?
The canonical SMILES for 5-butan-2-yl-3,4-dihydro-2H-1,4-benzoxazine is CCC(C)c1cccc2c1NCCO2.
What is the InChIKey of 5-butan-2-yl-3,4-dihydro-2H-1,4-benzoxazine?
The InChIKey is XDBZRYKHVSYGJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO/c1-3-9(2)10-5-4-6-11-12(10)13-7-8-14-11/h4-6,9,13H,3,7-8H2,1-2H3.
What are the key properties of 5-butan-2-yl-3,4-dihydro-2H-1,4-benzoxazine?
5-butan-2-yl-3,4-dihydro-2H-1,4-benzoxazine has a molecular weight of 191.27 g/mol, XLogP of 3.00, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-butan-2-yl-3,4-dihydro-2H-1,4-benzoxazine is sourced from PubChem (CID 137426093), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).