About 1-(5-bromo-2-pyridinyl)-2-(2,4-difluorophenyl)-1,1-difluoropentan-2-ol
1-(5-bromo-2-pyridinyl)-2-(2,4-difluorophenyl)-1,1-difluoropentan-2-ol (PubChem CID 137426930) has the molecular formula C16H14BrF4NO
and a molecular weight of 392.19 g/mol. Its IUPAC name is 1-(5-bromo-2-pyridinyl)-2-(2,4-difluorophenyl)-1,1-difluoropentan-2-ol.
Molecular Properties
| Compound Name | 1-(5-bromo-2-pyridinyl)-2-(2,4-difluorophenyl)-1,1-difluoropentan-2-ol |
| PubChem CID | 137426930 |
| Molecular Formula | C16H14BrF4NO |
| Molecular Weight | 392.19 g/mol |
| Exact Mass | 391.02 |
| IUPAC Name | 1-(5-bromo-2-pyridinyl)-2-(2,4-difluorophenyl)-1,1-difluoropentan-2-ol |
| SMILES | CCCC(O)(c1ccc(F)cc1F)C(F)(F)c1ccc(Br)cn1 |
| InChI | InChI=1S/C16H14BrF4NO/c1-2-7-15(23,12-5-4-11(18)8-13(12)19)16(20,21)14-6-3-10(17)9-22-14/h3-6,8-9,23H,2,7H2,1H3 |
| InChIKey | IUZZEQGLJQHIIN-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.19 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(5-bromo-2-pyridinyl)-2-(2,4-difluorophenyl)-1,1-difluoropentan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-bromo-2-pyridinyl)-2-(2,4-difluorophenyl)-1,1-difluoropentan-2-ol?
The IUPAC name of 1-(5-bromo-2-pyridinyl)-2-(2,4-difluorophenyl)-1,1-difluoropentan-2-ol (CID 137426930) is 1-(5-bromo-2-pyridinyl)-2-(2,4-difluorophenyl)-1,1-difluoropentan-2-ol.
What is the SMILES notation for 1-(5-bromo-2-pyridinyl)-2-(2,4-difluorophenyl)-1,1-difluoropentan-2-ol?
The canonical SMILES for 1-(5-bromo-2-pyridinyl)-2-(2,4-difluorophenyl)-1,1-difluoropentan-2-ol is CCCC(O)(c1ccc(F)cc1F)C(F)(F)c1ccc(Br)cn1.
What is the InChIKey of 1-(5-bromo-2-pyridinyl)-2-(2,4-difluorophenyl)-1,1-difluoropentan-2-ol?
The InChIKey is IUZZEQGLJQHIIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14BrF4NO/c1-2-7-15(23,12-5-4-11(18)8-13(12)19)16(20,21)14-6-3-10(17)9-22-14/h3-6,8-9,23H,2,7H2,1H3.
What are the key properties of 1-(5-bromo-2-pyridinyl)-2-(2,4-difluorophenyl)-1,1-difluoropentan-2-ol?
1-(5-bromo-2-pyridinyl)-2-(2,4-difluorophenyl)-1,1-difluoropentan-2-ol has a molecular weight of 392.19 g/mol, XLogP of 4.90, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-bromo-2-pyridinyl)-2-(2,4-difluorophenyl)-1,1-difluoropentan-2-ol is sourced from PubChem (CID 137426930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).