C21H20F4N6O — CID 137426956
N,N'-diamino-N-[2-(2,4-difluorophenyl)-3,3-difluoro-2-hydroxy-3-[5-(6-methyl-3-pyridinyl)-2-pyridinyl]propyl]methanimidamide (PubChem CID 137426956) has the molecular formula C21H20F4N6O and a molecular weight of 448.42 g/mol. Its IUPAC name is N,N'-diamino-N-[2-(2,4-difluorophenyl)-3,3-difluoro-2-hydroxy-3-[5-(6-methyl-3-pyridinyl)-2-pyridinyl]propyl]methanimidamide.
| Compound Name | N,N'-diamino-N-[2-(2,4-difluorophenyl)-3,3-difluoro-2-hydroxy-3-[5-(6-methyl-3-pyridinyl)-2-pyridinyl]propyl]methanimidamide |
|---|---|
| PubChem CID | 137426956 |
| Molecular Formula | C21H20F4N6O |
| Molecular Weight | 448.42 g/mol |
| Exact Mass | 448.16 |
| IUPAC Name | N,N'-diamino-N-[2-(2,4-difluorophenyl)-3,3-difluoro-2-hydroxy-3-[5-(6-methyl-3-pyridinyl)-2-pyridinyl]propyl]methanimidamide |
| SMILES | Cc1ccc(-c2ccc(C(F)(F)C(O)(CN(N)/C=N\N)c3ccc(F)cc3F)nc2)cn1 |
| InChI | InChI=1S/C21H20F4N6O/c1-13-2-3-14(9-28-13)15-4-7-19(29-10-15)21(24,25)20(32,11-31(27)12-30-26)17-6-5-16(22)8-18(17)23/h2-10,12,32H,11,26-27H2,1H3/b30-12- |
| InChIKey | AKJODHZOPIGHJH-FTCYSYDXSA-N |
| XLogP | 2.79 |
| TPSA | 113.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.42 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|