C20H17F6N5S — CID 137426998
N,N'-diamino-N-[3-[5-[5-(difluoromethyl)thiophen-2-yl]-2-pyridinyl]-2-(2,4-difluorophenyl)-3,3-difluoropropyl]methanimidamide (PubChem CID 137426998) has the molecular formula C20H17F6N5S and a molecular weight of 473.45 g/mol. Its IUPAC name is N,N'-diamino-N-[3-[5-[5-(difluoromethyl)thiophen-2-yl]-2-pyridinyl]-2-(2,4-difluorophenyl)-3,3-difluoropropyl]methanimidamide.
| Compound Name | N,N'-diamino-N-[3-[5-[5-(difluoromethyl)thiophen-2-yl]-2-pyridinyl]-2-(2,4-difluorophenyl)-3,3-difluoropropyl]methanimidamide |
|---|---|
| PubChem CID | 137426998 |
| Molecular Formula | C20H17F6N5S |
| Molecular Weight | 473.45 g/mol |
| Exact Mass | 473.11 |
| IUPAC Name | N,N'-diamino-N-[3-[5-[5-(difluoromethyl)thiophen-2-yl]-2-pyridinyl]-2-(2,4-difluorophenyl)-3,3-difluoropropyl]methanimidamide |
| SMILES | N/N=C\N(N)CC(c1ccc(F)cc1F)C(F)(F)c1ccc(-c2ccc(C(F)F)s2)cn1 |
| InChI | InChI=1S/C20H17F6N5S/c21-12-2-3-13(15(22)7-12)14(9-31(28)10-30-27)20(25,26)18-6-1-11(8-29-18)16-4-5-17(32-16)19(23)24/h1-8,10,14,19H,9,27-28H2/b30-10- |
| InChIKey | GGMSZUNSQQQPKE-TWUOJQIPSA-N |
| XLogP | 4.98 |
| TPSA | 80.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.45 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|