C22H21F4N5 — CID 137427057
N,N'-diamino-N-[3-(5-benzyl-2-pyridinyl)-2-(2,4-difluorophenyl)-3,3-difluoropropyl]methanimidamide (PubChem CID 137427057) has the molecular formula C22H21F4N5 and a molecular weight of 431.44 g/mol. Its IUPAC name is N,N'-diamino-N-[3-(5-benzyl-2-pyridinyl)-2-(2,4-difluorophenyl)-3,3-difluoropropyl]methanimidamide.
| Compound Name | N,N'-diamino-N-[3-(5-benzyl-2-pyridinyl)-2-(2,4-difluorophenyl)-3,3-difluoropropyl]methanimidamide |
|---|---|
| PubChem CID | 137427057 |
| Molecular Formula | C22H21F4N5 |
| Molecular Weight | 431.44 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | N,N'-diamino-N-[3-(5-benzyl-2-pyridinyl)-2-(2,4-difluorophenyl)-3,3-difluoropropyl]methanimidamide |
| SMILES | N/N=C\N(N)CC(c1ccc(F)cc1F)C(F)(F)c1ccc(Cc2ccccc2)cn1 |
| InChI | InChI=1S/C22H21F4N5/c23-17-7-8-18(20(24)11-17)19(13-31(28)14-30-27)22(25,26)21-9-6-16(12-29-21)10-15-4-2-1-3-5-15/h1-9,11-12,14,19H,10,13,27-28H2/b30-14- |
| InChIKey | JFGPKZOLZUGTNZ-CPDSRJINSA-N |
| XLogP | 3.90 |
| TPSA | 80.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.44 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|