About N-heptan-4-yl-5,6-dimethyl-2,3-dihydropyridine-2-carboxamide
N-heptan-4-yl-5,6-dimethyl-2,3-dihydropyridine-2-carboxamide (PubChem CID 137427086) has the molecular formula C15H26N2O
and a molecular weight of 250.39 g/mol. Its IUPAC name is N-heptan-4-yl-5,6-dimethyl-2,3-dihydropyridine-2-carboxamide.
Molecular Properties
| Compound Name | N-heptan-4-yl-5,6-dimethyl-2,3-dihydropyridine-2-carboxamide |
| PubChem CID | 137427086 |
| Molecular Formula | C15H26N2O |
| Molecular Weight | 250.39 g/mol |
| Exact Mass | 250.20 |
| IUPAC Name | N-heptan-4-yl-5,6-dimethyl-2,3-dihydropyridine-2-carboxamide |
| SMILES | CCCC(CCC)NC(=O)C1CC=C(C)C(C)=N1 |
| InChI | InChI=1S/C15H26N2O/c1-5-7-13(8-6-2)17-15(18)14-10-9-11(3)12(4)16-14/h9,13-14H,5-8,10H2,1-4H3,(H,17,18) |
| InChIKey | KEKCOAVANJDGPJ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.39 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-heptan-4-yl-5,6-dimethyl-2,3-dihydropyridine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-heptan-4-yl-5,6-dimethyl-2,3-dihydropyridine-2-carboxamide?
The IUPAC name of N-heptan-4-yl-5,6-dimethyl-2,3-dihydropyridine-2-carboxamide (CID 137427086) is N-heptan-4-yl-5,6-dimethyl-2,3-dihydropyridine-2-carboxamide.
What is the SMILES notation for N-heptan-4-yl-5,6-dimethyl-2,3-dihydropyridine-2-carboxamide?
The canonical SMILES for N-heptan-4-yl-5,6-dimethyl-2,3-dihydropyridine-2-carboxamide is CCCC(CCC)NC(=O)C1CC=C(C)C(C)=N1.
What is the InChIKey of N-heptan-4-yl-5,6-dimethyl-2,3-dihydropyridine-2-carboxamide?
The InChIKey is KEKCOAVANJDGPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H26N2O/c1-5-7-13(8-6-2)17-15(18)14-10-9-11(3)12(4)16-14/h9,13-14H,5-8,10H2,1-4H3,(H,17,18).
What are the key properties of N-heptan-4-yl-5,6-dimethyl-2,3-dihydropyridine-2-carboxamide?
N-heptan-4-yl-5,6-dimethyl-2,3-dihydropyridine-2-carboxamide has a molecular weight of 250.39 g/mol, XLogP of 3.25, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-heptan-4-yl-5,6-dimethyl-2,3-dihydropyridine-2-carboxamide is sourced from PubChem (CID 137427086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).