C15H20F3NO — CID 137427178
2,3,7-trifluoro-N-hexyl-5-methylcyclohepta-1,3,6-triene-1-carboxamide (PubChem CID 137427178) has the molecular formula C15H20F3NO and a molecular weight of 287.33 g/mol. Its IUPAC name is 2,3,7-trifluoro-N-hexyl-5-methylcyclohepta-1,3,6-triene-1-carboxamide.
| Compound Name | 2,3,7-trifluoro-N-hexyl-5-methylcyclohepta-1,3,6-triene-1-carboxamide |
|---|---|
| PubChem CID | 137427178 |
| Molecular Formula | C15H20F3NO |
| Molecular Weight | 287.33 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | 2,3,7-trifluoro-N-hexyl-5-methylcyclohepta-1,3,6-triene-1-carboxamide |
| SMILES | CCCCCCNC(=O)C1=C(F)C(F)=CC(C)C=C1F |
| InChI | InChI=1S/C15H20F3NO/c1-3-4-5-6-7-19-15(20)13-11(16)8-10(2)9-12(17)14(13)18/h8-10H,3-7H2,1-2H3,(H,19,20) |
| InChIKey | OCDCKQYMVQNXDR-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.33 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|