C16H24F3NO — CID 137427216
(2E,3E)-2-ethylidene-N-heptan-4-yl-4-(trifluoromethyl)hexa-3,5-dienamide (PubChem CID 137427216) has the molecular formula C16H24F3NO and a molecular weight of 303.37 g/mol. Its IUPAC name is (2E,3E)-2-ethylidene-N-heptan-4-yl-4-(trifluoromethyl)hexa-3,5-dienamide.
| Compound Name | (2E,3E)-2-ethylidene-N-heptan-4-yl-4-(trifluoromethyl)hexa-3,5-dienamide |
|---|---|
| PubChem CID | 137427216 |
| Molecular Formula | C16H24F3NO |
| Molecular Weight | 303.37 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | (2E,3E)-2-ethylidene-N-heptan-4-yl-4-(trifluoromethyl)hexa-3,5-dienamide |
| SMILES | C=C/C(=C\C(=C/C)C(=O)NC(CCC)CCC)C(F)(F)F |
| InChI | InChI=1S/C16H24F3NO/c1-5-9-14(10-6-2)20-15(21)12(7-3)11-13(8-4)16(17,18)19/h7-8,11,14H,4-6,9-10H2,1-3H3,(H,20,21)/b12-7+,13-11+ |
| InChIKey | YRTPLERZWCKCGB-ZPLWXOMKSA-N |
| XLogP | 4.69 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.37 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|