About N'-(fluoromethyl)-N-[(3Z)-2-methyliminohexa-3,5-dienyl]oxamide
N'-(fluoromethyl)-N-[(3Z)-2-methyliminohexa-3,5-dienyl]oxamide (PubChem CID 137427222) has the molecular formula C10H14FN3O2
and a molecular weight of 227.24 g/mol. Its IUPAC name is N'-(fluoromethyl)-N-[(3Z)-2-methyliminohexa-3,5-dienyl]oxamide.
Molecular Properties
| Compound Name | N'-(fluoromethyl)-N-[(3Z)-2-methyliminohexa-3,5-dienyl]oxamide |
| PubChem CID | 137427222 |
| Molecular Formula | C10H14FN3O2 |
| Molecular Weight | 227.24 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | N'-(fluoromethyl)-N-[(3Z)-2-methyliminohexa-3,5-dienyl]oxamide |
| SMILES | C=C/C=C\C(CNC(=O)C(=O)NCF)=N/C |
| InChI | InChI=1S/C10H14FN3O2/c1-3-4-5-8(12-2)6-13-9(15)10(16)14-7-11/h3-5H,1,6-7H2,2H3,(H,13,15)(H,14,16)/b5-4-,12-8+ |
| InChIKey | DGWXUJHTUKZPHS-KVIXIMHDSA-N |
| XLogP | -0.04 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.24 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N'-(fluoromethyl)-N-[(3Z)-2-methyliminohexa-3,5-dienyl]oxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(fluoromethyl)-N-[(3Z)-2-methyliminohexa-3,5-dienyl]oxamide?
The IUPAC name of N'-(fluoromethyl)-N-[(3Z)-2-methyliminohexa-3,5-dienyl]oxamide (CID 137427222) is N'-(fluoromethyl)-N-[(3Z)-2-methyliminohexa-3,5-dienyl]oxamide.
What is the SMILES notation for N'-(fluoromethyl)-N-[(3Z)-2-methyliminohexa-3,5-dienyl]oxamide?
The canonical SMILES for N'-(fluoromethyl)-N-[(3Z)-2-methyliminohexa-3,5-dienyl]oxamide is C=C/C=C\C(CNC(=O)C(=O)NCF)=N/C.
What is the InChIKey of N'-(fluoromethyl)-N-[(3Z)-2-methyliminohexa-3,5-dienyl]oxamide?
The InChIKey is DGWXUJHTUKZPHS-KVIXIMHDSA-N. The full InChI is InChI=1S/C10H14FN3O2/c1-3-4-5-8(12-2)6-13-9(15)10(16)14-7-11/h3-5H,1,6-7H2,2H3,(H,13,15)(H,14,16)/b5-4-,12-8+.
What are the key properties of N'-(fluoromethyl)-N-[(3Z)-2-methyliminohexa-3,5-dienyl]oxamide?
N'-(fluoromethyl)-N-[(3Z)-2-methyliminohexa-3,5-dienyl]oxamide has a molecular weight of 227.24 g/mol, XLogP of -0.04, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(fluoromethyl)-N-[(3Z)-2-methyliminohexa-3,5-dienyl]oxamide is sourced from PubChem (CID 137427222), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).