About (5E)-3-butyl-1,2-dimethyl-5-[(Z)-4-methylpent-2-enylidene]pyrrolidine
(5E)-3-butyl-1,2-dimethyl-5-[(Z)-4-methylpent-2-enylidene]pyrrolidine (PubChem CID 137427394) has the molecular formula C16H29N
and a molecular weight of 235.41 g/mol. Its IUPAC name is (5E)-3-butyl-1,2-dimethyl-5-[(Z)-4-methylpent-2-enylidene]pyrrolidine.
Molecular Properties
| Compound Name | (5E)-3-butyl-1,2-dimethyl-5-[(Z)-4-methylpent-2-enylidene]pyrrolidine |
| PubChem CID | 137427394 |
| Molecular Formula | C16H29N |
| Molecular Weight | 235.41 g/mol |
| Exact Mass | 235.23 |
| IUPAC Name | (5E)-3-butyl-1,2-dimethyl-5-[(Z)-4-methylpent-2-enylidene]pyrrolidine |
| SMILES | CCCCC1C/C(=C\C=C/C(C)C)N(C)C1C |
| InChI | InChI=1S/C16H29N/c1-6-7-10-15-12-16(17(5)14(15)4)11-8-9-13(2)3/h8-9,11,13-15H,6-7,10,12H2,1-5H3/b9-8-,16-11+ |
| InChIKey | WBDBJUYWDACRRS-RPKXPYLJSA-N |
| XLogP | 4.61 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.41 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (5E)-3-butyl-1,2-dimethyl-5-[(Z)-4-methylpent-2-enylidene]pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5E)-3-butyl-1,2-dimethyl-5-[(Z)-4-methylpent-2-enylidene]pyrrolidine?
The IUPAC name of (5E)-3-butyl-1,2-dimethyl-5-[(Z)-4-methylpent-2-enylidene]pyrrolidine (CID 137427394) is (5E)-3-butyl-1,2-dimethyl-5-[(Z)-4-methylpent-2-enylidene]pyrrolidine.
What is the SMILES notation for (5E)-3-butyl-1,2-dimethyl-5-[(Z)-4-methylpent-2-enylidene]pyrrolidine?
The canonical SMILES for (5E)-3-butyl-1,2-dimethyl-5-[(Z)-4-methylpent-2-enylidene]pyrrolidine is CCCCC1C/C(=C\C=C/C(C)C)N(C)C1C.
What is the InChIKey of (5E)-3-butyl-1,2-dimethyl-5-[(Z)-4-methylpent-2-enylidene]pyrrolidine?
The InChIKey is WBDBJUYWDACRRS-RPKXPYLJSA-N. The full InChI is InChI=1S/C16H29N/c1-6-7-10-15-12-16(17(5)14(15)4)11-8-9-13(2)3/h8-9,11,13-15H,6-7,10,12H2,1-5H3/b9-8-,16-11+.
What are the key properties of (5E)-3-butyl-1,2-dimethyl-5-[(Z)-4-methylpent-2-enylidene]pyrrolidine?
(5E)-3-butyl-1,2-dimethyl-5-[(Z)-4-methylpent-2-enylidene]pyrrolidine has a molecular weight of 235.41 g/mol, XLogP of 4.61, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (5E)-3-butyl-1,2-dimethyl-5-[(Z)-4-methylpent-2-enylidene]pyrrolidine is sourced from PubChem (CID 137427394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).