C14H17N3 — CID 137427445
3-but-3-enyl-4-(2,6-dimethylphenyl)-1,2,4-triazole (PubChem CID 137427445) has the molecular formula C14H17N3 and a molecular weight of 227.31 g/mol. Its IUPAC name is 3-but-3-enyl-4-(2,6-dimethylphenyl)-1,2,4-triazole.
| Compound Name | 3-but-3-enyl-4-(2,6-dimethylphenyl)-1,2,4-triazole |
|---|---|
| PubChem CID | 137427445 |
| Molecular Formula | C14H17N3 |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.14 |
| IUPAC Name | 3-but-3-enyl-4-(2,6-dimethylphenyl)-1,2,4-triazole |
| SMILES | C=CCCc1nncn1-c1c(C)cccc1C |
| InChI | InChI=1S/C14H17N3/c1-4-5-9-13-16-15-10-17(13)14-11(2)7-6-8-12(14)3/h4,6-8,10H,1,5,9H2,2-3H3 |
| InChIKey | FWQXMLYNVJMWCD-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|