C12H19NO — CID 137427535
4,7,9-trimethyl-3,7,8,9-tetrahydro-2H-cyclohepta[b][1,4]oxazine (PubChem CID 137427535) has the molecular formula C12H19NO and a molecular weight of 193.29 g/mol. Its IUPAC name is 4,7,9-trimethyl-3,7,8,9-tetrahydro-2H-cyclohepta[b][1,4]oxazine.
| Compound Name | 4,7,9-trimethyl-3,7,8,9-tetrahydro-2H-cyclohepta[b][1,4]oxazine |
|---|---|
| PubChem CID | 137427535 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | 4,7,9-trimethyl-3,7,8,9-tetrahydro-2H-cyclohepta[b][1,4]oxazine |
| SMILES | CC1C=CC2=C(OCCN2C)C(C)C1 |
| InChI | InChI=1S/C12H19NO/c1-9-4-5-11-12(10(2)8-9)14-7-6-13(11)3/h4-5,9-10H,6-8H2,1-3H3 |
| InChIKey | LMZADRCEKXHIBL-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |