About 7-amino-3,3-dimethylcyclohepta-1,6-diene-1-carbonitrile
7-amino-3,3-dimethylcyclohepta-1,6-diene-1-carbonitrile (PubChem CID 137427537) has the molecular formula C10H14N2
and a molecular weight of 162.24 g/mol. Its IUPAC name is 7-amino-3,3-dimethylcyclohepta-1,6-diene-1-carbonitrile.
Molecular Properties
| Compound Name | 7-amino-3,3-dimethylcyclohepta-1,6-diene-1-carbonitrile |
| PubChem CID | 137427537 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | 7-amino-3,3-dimethylcyclohepta-1,6-diene-1-carbonitrile |
| SMILES | CC1(C)C=C(C#N)C(N)=CCC1 |
| InChI | InChI=1S/C10H14N2/c1-10(2)5-3-4-9(12)8(6-10)7-11/h4,6H,3,5,12H2,1-2H3 |
| InChIKey | MOYRANLBQNABFB-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-amino-3,3-dimethylcyclohepta-1,6-diene-1-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-amino-3,3-dimethylcyclohepta-1,6-diene-1-carbonitrile?
The IUPAC name of 7-amino-3,3-dimethylcyclohepta-1,6-diene-1-carbonitrile (CID 137427537) is 7-amino-3,3-dimethylcyclohepta-1,6-diene-1-carbonitrile.
What is the SMILES notation for 7-amino-3,3-dimethylcyclohepta-1,6-diene-1-carbonitrile?
The canonical SMILES for 7-amino-3,3-dimethylcyclohepta-1,6-diene-1-carbonitrile is CC1(C)C=C(C#N)C(N)=CCC1.
What is the InChIKey of 7-amino-3,3-dimethylcyclohepta-1,6-diene-1-carbonitrile?
The InChIKey is MOYRANLBQNABFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2/c1-10(2)5-3-4-9(12)8(6-10)7-11/h4,6H,3,5,12H2,1-2H3.
What are the key properties of 7-amino-3,3-dimethylcyclohepta-1,6-diene-1-carbonitrile?
7-amino-3,3-dimethylcyclohepta-1,6-diene-1-carbonitrile has a molecular weight of 162.24 g/mol, XLogP of 2.10, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-amino-3,3-dimethylcyclohepta-1,6-diene-1-carbonitrile is sourced from PubChem (CID 137427537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).