About (5E)-5-[(Z)-3-methylpent-2-enylidene]-1,4-dihydroimidazole
(5E)-5-[(Z)-3-methylpent-2-enylidene]-1,4-dihydroimidazole (PubChem CID 137427544) has the molecular formula C9H14N2
and a molecular weight of 150.22 g/mol. Its IUPAC name is (5E)-5-[(Z)-3-methylpent-2-enylidene]-1,4-dihydroimidazole.
Molecular Properties
| Compound Name | (5E)-5-[(Z)-3-methylpent-2-enylidene]-1,4-dihydroimidazole |
| PubChem CID | 137427544 |
| Molecular Formula | C9H14N2 |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.12 |
| IUPAC Name | (5E)-5-[(Z)-3-methylpent-2-enylidene]-1,4-dihydroimidazole |
| SMILES | CC/C(C)=C\C=C1/CN=CN1 |
| InChI | InChI=1S/C9H14N2/c1-3-8(2)4-5-9-6-10-7-11-9/h4-5,7H,3,6H2,1-2H3,(H,10,11)/b8-4-,9-5+ |
| InChIKey | VKBUGUGWSVPCAT-MVTUOISNSA-N |
| XLogP | 1.86 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (5E)-5-[(Z)-3-methylpent-2-enylidene]-1,4-dihydroimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5E)-5-[(Z)-3-methylpent-2-enylidene]-1,4-dihydroimidazole?
The IUPAC name of (5E)-5-[(Z)-3-methylpent-2-enylidene]-1,4-dihydroimidazole (CID 137427544) is (5E)-5-[(Z)-3-methylpent-2-enylidene]-1,4-dihydroimidazole.
What is the SMILES notation for (5E)-5-[(Z)-3-methylpent-2-enylidene]-1,4-dihydroimidazole?
The canonical SMILES for (5E)-5-[(Z)-3-methylpent-2-enylidene]-1,4-dihydroimidazole is CC/C(C)=C\C=C1/CN=CN1.
What is the InChIKey of (5E)-5-[(Z)-3-methylpent-2-enylidene]-1,4-dihydroimidazole?
The InChIKey is VKBUGUGWSVPCAT-MVTUOISNSA-N. The full InChI is InChI=1S/C9H14N2/c1-3-8(2)4-5-9-6-10-7-11-9/h4-5,7H,3,6H2,1-2H3,(H,10,11)/b8-4-,9-5+.
What are the key properties of (5E)-5-[(Z)-3-methylpent-2-enylidene]-1,4-dihydroimidazole?
(5E)-5-[(Z)-3-methylpent-2-enylidene]-1,4-dihydroimidazole has a molecular weight of 150.22 g/mol, XLogP of 1.86, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5E)-5-[(Z)-3-methylpent-2-enylidene]-1,4-dihydroimidazole is sourced from PubChem (CID 137427544), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).