C9H15NO — CID 137427546
(3E,5E)-5-methoxyocta-1,3,5-trien-4-amine (PubChem CID 137427546) has the molecular formula C9H15NO and a molecular weight of 153.22 g/mol. Its IUPAC name is (3E,5E)-5-methoxyocta-1,3,5-trien-4-amine.
| Compound Name | (3E,5E)-5-methoxyocta-1,3,5-trien-4-amine |
|---|---|
| PubChem CID | 137427546 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.22 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | (3E,5E)-5-methoxyocta-1,3,5-trien-4-amine |
| SMILES | C=C/C=C(N)\C(=C/CC)OC |
| InChI | InChI=1S/C9H15NO/c1-4-6-8(10)9(11-3)7-5-2/h4,6-7H,1,5,10H2,2-3H3/b8-6+,9-7+ |
| InChIKey | FDCRZSGOEIDRRW-CDJQDVQCSA-N |
| XLogP | 1.96 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.22 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|