About 6,6-dimethyl-1,5-dihydrobenzimidazole
6,6-dimethyl-1,5-dihydrobenzimidazole (PubChem CID 137427616) has the molecular formula C9H12N2
and a molecular weight of 148.21 g/mol. Its IUPAC name is 6,6-dimethyl-1,5-dihydrobenzimidazole.
Molecular Properties
| Compound Name | 6,6-dimethyl-1,5-dihydrobenzimidazole |
| PubChem CID | 137427616 |
| Molecular Formula | C9H12N2 |
| Molecular Weight | 148.21 g/mol |
| Exact Mass | 148.10 |
| IUPAC Name | 6,6-dimethyl-1,5-dihydrobenzimidazole |
| SMILES | CC1(C)C=c2[nH]cnc2=CC1 |
| InChI | InChI=1S/C9H12N2/c1-9(2)4-3-7-8(5-9)11-6-10-7/h3,5-6H,4H2,1-2H3,(H,10,11) |
| InChIKey | IOFWVDYOHNFNDT-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.21 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6,6-dimethyl-1,5-dihydrobenzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,6-dimethyl-1,5-dihydrobenzimidazole?
The IUPAC name of 6,6-dimethyl-1,5-dihydrobenzimidazole (CID 137427616) is 6,6-dimethyl-1,5-dihydrobenzimidazole.
What is the SMILES notation for 6,6-dimethyl-1,5-dihydrobenzimidazole?
The canonical SMILES for 6,6-dimethyl-1,5-dihydrobenzimidazole is CC1(C)C=c2[nH]cnc2=CC1.
What is the InChIKey of 6,6-dimethyl-1,5-dihydrobenzimidazole?
The InChIKey is IOFWVDYOHNFNDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2/c1-9(2)4-3-7-8(5-9)11-6-10-7/h3,5-6H,4H2,1-2H3,(H,10,11).
What are the key properties of 6,6-dimethyl-1,5-dihydrobenzimidazole?
6,6-dimethyl-1,5-dihydrobenzimidazole has a molecular weight of 148.21 g/mol, XLogP of 0.40, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6,6-dimethyl-1,5-dihydrobenzimidazole is sourced from PubChem (CID 137427616), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).