C10H17NO — CID 137427656
(3E,5Z)-3-methoxy-N,5-dimethylhepta-1,3,5-trien-2-amine (PubChem CID 137427656) has the molecular formula C10H17NO and a molecular weight of 167.25 g/mol. Its IUPAC name is (3E,5Z)-3-methoxy-N,5-dimethylhepta-1,3,5-trien-2-amine.
| Compound Name | (3E,5Z)-3-methoxy-N,5-dimethylhepta-1,3,5-trien-2-amine |
|---|---|
| PubChem CID | 137427656 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | (3E,5Z)-3-methoxy-N,5-dimethylhepta-1,3,5-trien-2-amine |
| SMILES | C=C(NC)/C(=C\C(C)=C/C)OC |
| InChI | InChI=1S/C10H17NO/c1-6-8(2)7-10(12-5)9(3)11-4/h6-7,11H,3H2,1-2,4-5H3/b8-6-,10-7+ |
| InChIKey | ZBJLPUFIIDQEPZ-GOOBONSCSA-N |
| XLogP | 2.22 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|