About (4E,5E)-2-methyl-5-(3-methylbutylidene)-4-prop-2-enylidene-1,3-oxazole
(4E,5E)-2-methyl-5-(3-methylbutylidene)-4-prop-2-enylidene-1,3-oxazole (PubChem CID 137427739) has the molecular formula C12H17NO
and a molecular weight of 191.27 g/mol. Its IUPAC name is (4E,5E)-2-methyl-5-(3-methylbutylidene)-4-prop-2-enylidene-1,3-oxazole.
Molecular Properties
| Compound Name | (4E,5E)-2-methyl-5-(3-methylbutylidene)-4-prop-2-enylidene-1,3-oxazole |
| PubChem CID | 137427739 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | (4E,5E)-2-methyl-5-(3-methylbutylidene)-4-prop-2-enylidene-1,3-oxazole |
| SMILES | C=C/C=c1/nc(C)o/c1=C/CC(C)C |
| InChI | InChI=1S/C12H17NO/c1-5-6-11-12(8-7-9(2)3)14-10(4)13-11/h5-6,8-9H,1,7H2,2-4H3/b11-6+,12-8+ |
| InChIKey | LNGMLWMUSUYCTI-DECBNBDHSA-N |
| XLogP | 1.78 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4E,5E)-2-methyl-5-(3-methylbutylidene)-4-prop-2-enylidene-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4E,5E)-2-methyl-5-(3-methylbutylidene)-4-prop-2-enylidene-1,3-oxazole?
The IUPAC name of (4E,5E)-2-methyl-5-(3-methylbutylidene)-4-prop-2-enylidene-1,3-oxazole (CID 137427739) is (4E,5E)-2-methyl-5-(3-methylbutylidene)-4-prop-2-enylidene-1,3-oxazole.
What is the SMILES notation for (4E,5E)-2-methyl-5-(3-methylbutylidene)-4-prop-2-enylidene-1,3-oxazole?
The canonical SMILES for (4E,5E)-2-methyl-5-(3-methylbutylidene)-4-prop-2-enylidene-1,3-oxazole is C=C/C=c1/nc(C)o/c1=C/CC(C)C.
What is the InChIKey of (4E,5E)-2-methyl-5-(3-methylbutylidene)-4-prop-2-enylidene-1,3-oxazole?
The InChIKey is LNGMLWMUSUYCTI-DECBNBDHSA-N. The full InChI is InChI=1S/C12H17NO/c1-5-6-11-12(8-7-9(2)3)14-10(4)13-11/h5-6,8-9H,1,7H2,2-4H3/b11-6+,12-8+.
What are the key properties of (4E,5E)-2-methyl-5-(3-methylbutylidene)-4-prop-2-enylidene-1,3-oxazole?
(4E,5E)-2-methyl-5-(3-methylbutylidene)-4-prop-2-enylidene-1,3-oxazole has a molecular weight of 191.27 g/mol, XLogP of 1.78, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4E,5E)-2-methyl-5-(3-methylbutylidene)-4-prop-2-enylidene-1,3-oxazole is sourced from PubChem (CID 137427739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).