C19H35NO3 — CID 137427832
2-[[(3Z,5R,6S,7S,8E)-7-methoxy-3,5-dimethyl-1-oxacyclotetradeca-3,8-dien-6-yl]oxy]-N-methylethanamine (PubChem CID 137427832) has the molecular formula C19H35NO3 and a molecular weight of 325.49 g/mol. Its IUPAC name is 2-[[(3Z,5R,6S,7S,8E)-7-methoxy-3,5-dimethyl-1-oxacyclotetradeca-3,8-dien-6-yl]oxy]-N-methylethanamine.
| Compound Name | 2-[[(3Z,5R,6S,7S,8E)-7-methoxy-3,5-dimethyl-1-oxacyclotetradeca-3,8-dien-6-yl]oxy]-N-methylethanamine |
|---|---|
| PubChem CID | 137427832 |
| Molecular Formula | C19H35NO3 |
| Molecular Weight | 325.49 g/mol |
| Exact Mass | 325.26 |
| IUPAC Name | 2-[[(3Z,5R,6S,7S,8E)-7-methoxy-3,5-dimethyl-1-oxacyclotetradeca-3,8-dien-6-yl]oxy]-N-methylethanamine |
| SMILES | CNCCO[C@H]1[C@H](C)/C=C(/C)COCCCCC/C=C/[C@@H]1OC |
| InChI | InChI=1S/C19H35NO3/c1-16-14-17(2)19(23-13-11-20-3)18(21-4)10-8-6-5-7-9-12-22-15-16/h8,10,14,17-20H,5-7,9,11-13,15H2,1-4H3/b10-8+,16-14-/t17-,18+,19+/m1/s1 |
| InChIKey | LMAPXHYATRGVLA-PXWWXNNYSA-N |
| XLogP | 3.34 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.49 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|