C10H17Cl — CID 137428084
(1S,4R,6R)-4-(chloromethyl)-1,5-dimethylbicyclo[4.1.0]heptane (PubChem CID 137428084) has the molecular formula C10H17Cl and a molecular weight of 172.70 g/mol. Its IUPAC name is (1S,4R,6R)-4-(chloromethyl)-1,5-dimethylbicyclo[4.1.0]heptane.
| Compound Name | (1S,4R,6R)-4-(chloromethyl)-1,5-dimethylbicyclo[4.1.0]heptane |
|---|---|
| PubChem CID | 137428084 |
| Molecular Formula | C10H17Cl |
| Molecular Weight | 172.70 g/mol |
| Exact Mass | 172.10 |
| IUPAC Name | (1S,4R,6R)-4-(chloromethyl)-1,5-dimethylbicyclo[4.1.0]heptane |
| SMILES | CC1[C@H](CCl)CC[C@@]2(C)C[C@H]12 |
| InChI | InChI=1S/C10H17Cl/c1-7-8(6-11)3-4-10(2)5-9(7)10/h7-9H,3-6H2,1-2H3/t7?,8-,9+,10-/m0/s1 |
| InChIKey | OPYOJPASCHLPRC-UPBARMNASA-N |
| XLogP | 3.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.70 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|