C73H62IN7 — CID 137428247
5-[2-[4-(3-butyl-5-iodophenyl)-6-(3,5-dibutylphenyl)-1,3,5-triazin-2-yl]-4-(4,6-diphenylpyrimidin-2-yl)phenyl]-7-phenylindolo[2,3-b]carbazole (PubChem CID 137428247) has the molecular formula C73H62IN7 and a molecular weight of 1164.25 g/mol. Its IUPAC name is 5-[2-[4-(3-butyl-5-iodophenyl)-6-(3,5-dibutylphenyl)-1,3,5-triazin-2-yl]-4-(4,6-diphenylpyrimidin-2-yl)phenyl]-7-phenylindolo[2,3-b]carbazole.
| Compound Name | 5-[2-[4-(3-butyl-5-iodophenyl)-6-(3,5-dibutylphenyl)-1,3,5-triazin-2-yl]-4-(4,6-diphenylpyrimidin-2-yl)phenyl]-7-phenylindolo[2,3-b]carbazole |
|---|---|
| PubChem CID | 137428247 |
| Molecular Formula | C73H62IN7 |
| Molecular Weight | 1164.25 g/mol |
| Exact Mass | 1163.41 |
| IUPAC Name | 5-[2-[4-(3-butyl-5-iodophenyl)-6-(3,5-dibutylphenyl)-1,3,5-triazin-2-yl]-4-(4,6-diphenylpyrimidin-2-yl)phenyl]-7-phenylindolo[2,3-b]carbazole |
| SMILES | CCCCc1cc(I)cc(-c2nc(-c3cc(CCCC)cc(CCCC)c3)nc(-c3cc(-c4nc(-c5ccccc5)cc(-c5ccccc5)n4)ccc3-n3c4ccccc4c4cc5c6ccccc6n(-c6ccccc6)c5cc43)n2)c1 |
| InChI | InChI=1S/C73H62IN7/c1-4-7-23-48-38-49(24-8-5-2)40-54(39-48)71-77-72(55-41-50(25-9-6-3)42-56(74)43-55)79-73(78-71)62-44-53(70-75-63(51-26-13-10-14-27-51)46-64(76-70)52-28-15-11-16-29-52)36-37-67(62)81-66-35-22-20-33-59(66)61-45-60-58-32-19-21-34-65(58)80(68(60)47-69(61)81)57-30-17-12-18-31-57/h10-22,26-47H,4-9,23-25H2,1-3H3 |
| InChIKey | BTQORZHJWNZWDP-UHFFFAOYSA-N |
| XLogP | 19.49 |
| TPSA | 74.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 81 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1164.25 |
| LogP ≤ 5 | 19.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|