C17H33NO6 — CID 137429200
2-(hydroxymethyl)-3-(2-methylbutan-2-yloxy)-6-(3-methylpentan-3-yloxy)-5-nitrosooxan-4-ol (PubChem CID 137429200) has the molecular formula C17H33NO6 and a molecular weight of 347.45 g/mol. Its IUPAC name is 2-(hydroxymethyl)-3-(2-methylbutan-2-yloxy)-6-(3-methylpentan-3-yloxy)-5-nitrosooxan-4-ol.
| Compound Name | 2-(hydroxymethyl)-3-(2-methylbutan-2-yloxy)-6-(3-methylpentan-3-yloxy)-5-nitrosooxan-4-ol |
|---|---|
| PubChem CID | 137429200 |
| Molecular Formula | C17H33NO6 |
| Molecular Weight | 347.45 g/mol |
| Exact Mass | 347.23 |
| IUPAC Name | 2-(hydroxymethyl)-3-(2-methylbutan-2-yloxy)-6-(3-methylpentan-3-yloxy)-5-nitrosooxan-4-ol |
| SMILES | CCC(C)(C)OC1C(CO)OC(OC(C)(CC)CC)C(N=O)C1O |
| InChI | InChI=1S/C17H33NO6/c1-7-16(4,5)23-14-11(10-19)22-15(12(18-21)13(14)20)24-17(6,8-2)9-3/h11-15,19-20H,7-10H2,1-6H3 |
| InChIKey | RFCUHRFBTKFHMV-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 97.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.45 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |