C25H23N5OS — CID 137429471
N-(2-methoxyethyl)-2-(1-methylimidazol-4-yl)-5,6-diphenylthieno[2,3-d]pyrimidin-4-amine (PubChem CID 137429471) has the molecular formula C25H23N5OS and a molecular weight of 441.56 g/mol. Its IUPAC name is N-(2-methoxyethyl)-2-(1-methylimidazol-4-yl)-5,6-diphenylthieno[2,3-d]pyrimidin-4-amine.
| Compound Name | N-(2-methoxyethyl)-2-(1-methylimidazol-4-yl)-5,6-diphenylthieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 137429471 |
| Molecular Formula | C25H23N5OS |
| Molecular Weight | 441.56 g/mol |
| Exact Mass | 441.16 |
| IUPAC Name | N-(2-methoxyethyl)-2-(1-methylimidazol-4-yl)-5,6-diphenylthieno[2,3-d]pyrimidin-4-amine |
| SMILES | COCCNc1nc(-c2cn(C)cn2)nc2sc(-c3ccccc3)c(-c3ccccc3)c12 |
| InChI | InChI=1S/C25H23N5OS/c1-30-15-19(27-16-30)23-28-24(26-13-14-31-2)21-20(17-9-5-3-6-10-17)22(32-25(21)29-23)18-11-7-4-8-12-18/h3-12,15-16H,13-14H2,1-2H3,(H,26,28,29) |
| InChIKey | RKVHWVSLOGEMSF-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.56 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|