C25H20F3N5OS — CID 137429659
2-(1-methylimidazol-2-yl)-5,6-diphenyl-N-[2-(trifluoromethoxy)ethyl]thieno[2,3-d]pyrimidin-4-amine (PubChem CID 137429659) has the molecular formula C25H20F3N5OS and a molecular weight of 495.53 g/mol. Its IUPAC name is 2-(1-methylimidazol-2-yl)-5,6-diphenyl-N-[2-(trifluoromethoxy)ethyl]thieno[2,3-d]pyrimidin-4-amine.
| Compound Name | 2-(1-methylimidazol-2-yl)-5,6-diphenyl-N-[2-(trifluoromethoxy)ethyl]thieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 137429659 |
| Molecular Formula | C25H20F3N5OS |
| Molecular Weight | 495.53 g/mol |
| Exact Mass | 495.13 |
| IUPAC Name | 2-(1-methylimidazol-2-yl)-5,6-diphenyl-N-[2-(trifluoromethoxy)ethyl]thieno[2,3-d]pyrimidin-4-amine |
| SMILES | Cn1ccnc1-c1nc(NCCOC(F)(F)F)c2c(-c3ccccc3)c(-c3ccccc3)sc2n1 |
| InChI | InChI=1S/C25H20F3N5OS/c1-33-14-12-30-23(33)22-31-21(29-13-15-34-25(26,27)28)19-18(16-8-4-2-5-9-16)20(35-24(19)32-22)17-10-6-3-7-11-17/h2-12,14H,13,15H2,1H3,(H,29,31,32) |
| InChIKey | VDSINMJKQCVORY-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.53 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|