C24H23N5O4S — CID 137429664
N-[2-(3,4-dihydroxyphenyl)ethyl]-4-morpholin-4-yl-2-pyridin-2-ylthieno[2,3-d]pyrimidine-5-carboxamide (PubChem CID 137429664) has the molecular formula C24H23N5O4S and a molecular weight of 477.55 g/mol. Its IUPAC name is N-[2-(3,4-dihydroxyphenyl)ethyl]-4-morpholin-4-yl-2-pyridin-2-ylthieno[2,3-d]pyrimidine-5-carboxamide.
| Compound Name | N-[2-(3,4-dihydroxyphenyl)ethyl]-4-morpholin-4-yl-2-pyridin-2-ylthieno[2,3-d]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 137429664 |
| Molecular Formula | C24H23N5O4S |
| Molecular Weight | 477.55 g/mol |
| Exact Mass | 477.15 |
| IUPAC Name | N-[2-(3,4-dihydroxyphenyl)ethyl]-4-morpholin-4-yl-2-pyridin-2-ylthieno[2,3-d]pyrimidine-5-carboxamide |
| SMILES | O=C(NCCc1ccc(O)c(O)c1)c1csc2nc(-c3ccccn3)nc(N3CCOCC3)c12 |
| InChI | InChI=1S/C24H23N5O4S/c30-18-5-4-15(13-19(18)31)6-8-26-23(32)16-14-34-24-20(16)22(29-9-11-33-12-10-29)27-21(28-24)17-3-1-2-7-25-17/h1-5,7,13-14,30-31H,6,8-12H2,(H,26,32) |
| InChIKey | CCOXDQDVMYVOJN-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 120.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.55 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|