C10H18N4 — CID 137430111
(Z)-1-N'-methyl-2-(methylideneamino)-1-N'-[[[(3Z)-penta-1,3-dien-2-yl]amino]methyl]ethene-1,1-diamine (PubChem CID 137430111) has the molecular formula C10H18N4 and a molecular weight of 194.28 g/mol. Its IUPAC name is (Z)-1-N'-methyl-2-(methylideneamino)-1-N'-[[[(3Z)-penta-1,3-dien-2-yl]amino]methyl]ethene-1,1-diamine.
| Compound Name | (Z)-1-N'-methyl-2-(methylideneamino)-1-N'-[[[(3Z)-penta-1,3-dien-2-yl]amino]methyl]ethene-1,1-diamine |
|---|---|
| PubChem CID | 137430111 |
| Molecular Formula | C10H18N4 |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.15 |
| IUPAC Name | (Z)-1-N'-methyl-2-(methylideneamino)-1-N'-[[[(3Z)-penta-1,3-dien-2-yl]amino]methyl]ethene-1,1-diamine |
| SMILES | C=N/C=C(/N)N(C)CNC(=C)/C=C\C |
| InChI | InChI=1S/C10H18N4/c1-5-6-9(2)13-8-14(4)10(11)7-12-3/h5-7,13H,2-3,8,11H2,1,4H3/b6-5-,10-7- |
| InChIKey | ZQHDMVHLUZKGTI-ICZHLNMZSA-N |
| XLogP | 1.01 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|