About 4-[5-amino-3-(4,5-dimethyl-1,3-oxazol-2-yl)pyrazin-2-yl]-2-chlorophenol
4-[5-amino-3-(4,5-dimethyl-1,3-oxazol-2-yl)pyrazin-2-yl]-2-chlorophenol (PubChem CID 137430113) has the molecular formula C15H13ClN4O2
and a molecular weight of 316.75 g/mol. Its IUPAC name is 4-[5-amino-3-(4,5-dimethyl-1,3-oxazol-2-yl)pyrazin-2-yl]-2-chlorophenol.
Molecular Properties
| Compound Name | 4-[5-amino-3-(4,5-dimethyl-1,3-oxazol-2-yl)pyrazin-2-yl]-2-chlorophenol |
| PubChem CID | 137430113 |
| Molecular Formula | C15H13ClN4O2 |
| Molecular Weight | 316.75 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | 4-[5-amino-3-(4,5-dimethyl-1,3-oxazol-2-yl)pyrazin-2-yl]-2-chlorophenol |
| SMILES | Cc1nc(-c2nc(N)cnc2-c2ccc(O)c(Cl)c2)oc1C |
| InChI | InChI=1S/C15H13ClN4O2/c1-7-8(2)22-15(19-7)14-13(18-6-12(17)20-14)9-3-4-11(21)10(16)5-9/h3-6,21H,1-2H3,(H2,17,20) |
| InChIKey | ICDNLGVSZWSLLN-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 98.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.75 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[5-amino-3-(4,5-dimethyl-1,3-oxazol-2-yl)pyrazin-2-yl]-2-chlorophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[5-amino-3-(4,5-dimethyl-1,3-oxazol-2-yl)pyrazin-2-yl]-2-chlorophenol?
The IUPAC name of 4-[5-amino-3-(4,5-dimethyl-1,3-oxazol-2-yl)pyrazin-2-yl]-2-chlorophenol (CID 137430113) is 4-[5-amino-3-(4,5-dimethyl-1,3-oxazol-2-yl)pyrazin-2-yl]-2-chlorophenol.
What is the SMILES notation for 4-[5-amino-3-(4,5-dimethyl-1,3-oxazol-2-yl)pyrazin-2-yl]-2-chlorophenol?
The canonical SMILES for 4-[5-amino-3-(4,5-dimethyl-1,3-oxazol-2-yl)pyrazin-2-yl]-2-chlorophenol is Cc1nc(-c2nc(N)cnc2-c2ccc(O)c(Cl)c2)oc1C.
What is the InChIKey of 4-[5-amino-3-(4,5-dimethyl-1,3-oxazol-2-yl)pyrazin-2-yl]-2-chlorophenol?
The InChIKey is ICDNLGVSZWSLLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13ClN4O2/c1-7-8(2)22-15(19-7)14-13(18-6-12(17)20-14)9-3-4-11(21)10(16)5-9/h3-6,21H,1-2H3,(H2,17,20).
What are the key properties of 4-[5-amino-3-(4,5-dimethyl-1,3-oxazol-2-yl)pyrazin-2-yl]-2-chlorophenol?
4-[5-amino-3-(4,5-dimethyl-1,3-oxazol-2-yl)pyrazin-2-yl]-2-chlorophenol has a molecular weight of 316.75 g/mol, XLogP of 3.36, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[5-amino-3-(4,5-dimethyl-1,3-oxazol-2-yl)pyrazin-2-yl]-2-chlorophenol is sourced from PubChem (CID 137430113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).