C15H27N — CID 137430122
N-[(1Z,3E)-2-(2,2-dimethylpropyl)-4,5,5-trimethylhexa-1,3-dienyl]methanimine (PubChem CID 137430122) has the molecular formula C15H27N and a molecular weight of 221.39 g/mol. Its IUPAC name is N-[(1Z,3E)-2-(2,2-dimethylpropyl)-4,5,5-trimethylhexa-1,3-dienyl]methanimine.
| Compound Name | N-[(1Z,3E)-2-(2,2-dimethylpropyl)-4,5,5-trimethylhexa-1,3-dienyl]methanimine |
|---|---|
| PubChem CID | 137430122 |
| Molecular Formula | C15H27N |
| Molecular Weight | 221.39 g/mol |
| Exact Mass | 221.21 |
| IUPAC Name | N-[(1Z,3E)-2-(2,2-dimethylpropyl)-4,5,5-trimethylhexa-1,3-dienyl]methanimine |
| SMILES | C=N/C=C(\C=C(/C)C(C)(C)C)CC(C)(C)C |
| InChI | InChI=1S/C15H27N/c1-12(15(5,6)7)9-13(11-16-8)10-14(2,3)4/h9,11H,8,10H2,1-7H3/b12-9+,13-11+ |
| InChIKey | NZOXSQPDLDQXJZ-RBDPUHSXSA-N |
| XLogP | 5.00 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.39 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|