About 5-quinolin-6-yl-6-(1,3-thiazol-5-yl)pyrazin-2-amine
5-quinolin-6-yl-6-(1,3-thiazol-5-yl)pyrazin-2-amine (PubChem CID 137430152) has the molecular formula C16H11N5S
and a molecular weight of 305.37 g/mol. Its IUPAC name is 5-quinolin-6-yl-6-(1,3-thiazol-5-yl)pyrazin-2-amine.
Molecular Properties
| Compound Name | 5-quinolin-6-yl-6-(1,3-thiazol-5-yl)pyrazin-2-amine |
| PubChem CID | 137430152 |
| Molecular Formula | C16H11N5S |
| Molecular Weight | 305.37 g/mol |
| Exact Mass | 305.07 |
| IUPAC Name | 5-quinolin-6-yl-6-(1,3-thiazol-5-yl)pyrazin-2-amine |
| SMILES | Nc1cnc(-c2ccc3ncccc3c2)c(-c2cncs2)n1 |
| InChI | InChI=1S/C16H11N5S/c17-14-8-20-15(16(21-14)13-7-18-9-22-13)11-3-4-12-10(6-11)2-1-5-19-12/h1-9H,(H2,17,21) |
| InChIKey | YDWAGRAGRSYGJH-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 77.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.37 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-quinolin-6-yl-6-(1,3-thiazol-5-yl)pyrazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-quinolin-6-yl-6-(1,3-thiazol-5-yl)pyrazin-2-amine?
The IUPAC name of 5-quinolin-6-yl-6-(1,3-thiazol-5-yl)pyrazin-2-amine (CID 137430152) is 5-quinolin-6-yl-6-(1,3-thiazol-5-yl)pyrazin-2-amine.
What is the SMILES notation for 5-quinolin-6-yl-6-(1,3-thiazol-5-yl)pyrazin-2-amine?
The canonical SMILES for 5-quinolin-6-yl-6-(1,3-thiazol-5-yl)pyrazin-2-amine is Nc1cnc(-c2ccc3ncccc3c2)c(-c2cncs2)n1.
What is the InChIKey of 5-quinolin-6-yl-6-(1,3-thiazol-5-yl)pyrazin-2-amine?
The InChIKey is YDWAGRAGRSYGJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11N5S/c17-14-8-20-15(16(21-14)13-7-18-9-22-13)11-3-4-12-10(6-11)2-1-5-19-12/h1-9H,(H2,17,21).
What are the key properties of 5-quinolin-6-yl-6-(1,3-thiazol-5-yl)pyrazin-2-amine?
5-quinolin-6-yl-6-(1,3-thiazol-5-yl)pyrazin-2-amine has a molecular weight of 305.37 g/mol, XLogP of 3.40, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-quinolin-6-yl-6-(1,3-thiazol-5-yl)pyrazin-2-amine is sourced from PubChem (CID 137430152), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).