About 1-[6-amino-3-(4-chloro-1,3-benzothiazol-6-yl)pyrazin-2-yl]pyridin-2-one
1-[6-amino-3-(4-chloro-1,3-benzothiazol-6-yl)pyrazin-2-yl]pyridin-2-one (PubChem CID 137430218) has the molecular formula C16H10ClN5OS
and a molecular weight of 355.81 g/mol. Its IUPAC name is 1-[6-amino-3-(4-chloro-1,3-benzothiazol-6-yl)pyrazin-2-yl]pyridin-2-one.
Molecular Properties
| Compound Name | 1-[6-amino-3-(4-chloro-1,3-benzothiazol-6-yl)pyrazin-2-yl]pyridin-2-one |
| PubChem CID | 137430218 |
| Molecular Formula | C16H10ClN5OS |
| Molecular Weight | 355.81 g/mol |
| Exact Mass | 355.03 |
| IUPAC Name | 1-[6-amino-3-(4-chloro-1,3-benzothiazol-6-yl)pyrazin-2-yl]pyridin-2-one |
| SMILES | Nc1cnc(-c2cc(Cl)c3ncsc3c2)c(-n2ccccc2=O)n1 |
| InChI | InChI=1S/C16H10ClN5OS/c17-10-5-9(6-11-15(10)20-8-24-11)14-16(21-12(18)7-19-14)22-4-2-1-3-13(22)23/h1-8H,(H2,18,21) |
| InChIKey | UBFJXDCJHBZHSA-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 86.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.81 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1-[6-amino-3-(4-chloro-1,3-benzothiazol-6-yl)pyrazin-2-yl]pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[6-amino-3-(4-chloro-1,3-benzothiazol-6-yl)pyrazin-2-yl]pyridin-2-one?
The IUPAC name of 1-[6-amino-3-(4-chloro-1,3-benzothiazol-6-yl)pyrazin-2-yl]pyridin-2-one (CID 137430218) is 1-[6-amino-3-(4-chloro-1,3-benzothiazol-6-yl)pyrazin-2-yl]pyridin-2-one.
What is the SMILES notation for 1-[6-amino-3-(4-chloro-1,3-benzothiazol-6-yl)pyrazin-2-yl]pyridin-2-one?
The canonical SMILES for 1-[6-amino-3-(4-chloro-1,3-benzothiazol-6-yl)pyrazin-2-yl]pyridin-2-one is Nc1cnc(-c2cc(Cl)c3ncsc3c2)c(-n2ccccc2=O)n1.
What is the InChIKey of 1-[6-amino-3-(4-chloro-1,3-benzothiazol-6-yl)pyrazin-2-yl]pyridin-2-one?
The InChIKey is UBFJXDCJHBZHSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10ClN5OS/c17-10-5-9(6-11-15(10)20-8-24-11)14-16(21-12(18)7-19-14)22-4-2-1-3-13(22)23/h1-8H,(H2,18,21).
What are the key properties of 1-[6-amino-3-(4-chloro-1,3-benzothiazol-6-yl)pyrazin-2-yl]pyridin-2-one?
1-[6-amino-3-(4-chloro-1,3-benzothiazol-6-yl)pyrazin-2-yl]pyridin-2-one has a molecular weight of 355.81 g/mol, XLogP of 3.14, 2 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[6-amino-3-(4-chloro-1,3-benzothiazol-6-yl)pyrazin-2-yl]pyridin-2-one is sourced from PubChem (CID 137430218), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).