About 5-(8-chloroquinolin-6-yl)-3-N-[(4-fluorophenyl)methyl]-6-phenylpyrazine-2,3-diamine
5-(8-chloroquinolin-6-yl)-3-N-[(4-fluorophenyl)methyl]-6-phenylpyrazine-2,3-diamine (PubChem CID 137430425) has the molecular formula C26H19ClFN5
and a molecular weight of 455.92 g/mol. Its IUPAC name is 5-(8-chloroquinolin-6-yl)-3-N-[(4-fluorophenyl)methyl]-6-phenylpyrazine-2,3-diamine.
Molecular Properties
| Compound Name | 5-(8-chloroquinolin-6-yl)-3-N-[(4-fluorophenyl)methyl]-6-phenylpyrazine-2,3-diamine |
| PubChem CID | 137430425 |
| Molecular Formula | C26H19ClFN5 |
| Molecular Weight | 455.92 g/mol |
| Exact Mass | 455.13 |
| IUPAC Name | 5-(8-chloroquinolin-6-yl)-3-N-[(4-fluorophenyl)methyl]-6-phenylpyrazine-2,3-diamine |
| SMILES | Nc1nc(-c2ccccc2)c(-c2cc(Cl)c3ncccc3c2)nc1NCc1ccc(F)cc1 |
| InChI | InChI=1S/C26H19ClFN5/c27-21-14-19(13-18-7-4-12-30-22(18)21)24-23(17-5-2-1-3-6-17)32-25(29)26(33-24)31-15-16-8-10-20(28)11-9-16/h1-14H,15H2,(H2,29,32)(H,31,33) |
| InChIKey | YDZMBTWBOSURMB-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 455.92 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-(8-chloroquinolin-6-yl)-3-N-[(4-fluorophenyl)methyl]-6-phenylpyrazine-2,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(8-chloroquinolin-6-yl)-3-N-[(4-fluorophenyl)methyl]-6-phenylpyrazine-2,3-diamine?
The IUPAC name of 5-(8-chloroquinolin-6-yl)-3-N-[(4-fluorophenyl)methyl]-6-phenylpyrazine-2,3-diamine (CID 137430425) is 5-(8-chloroquinolin-6-yl)-3-N-[(4-fluorophenyl)methyl]-6-phenylpyrazine-2,3-diamine.
What is the SMILES notation for 5-(8-chloroquinolin-6-yl)-3-N-[(4-fluorophenyl)methyl]-6-phenylpyrazine-2,3-diamine?
The canonical SMILES for 5-(8-chloroquinolin-6-yl)-3-N-[(4-fluorophenyl)methyl]-6-phenylpyrazine-2,3-diamine is Nc1nc(-c2ccccc2)c(-c2cc(Cl)c3ncccc3c2)nc1NCc1ccc(F)cc1.
What is the InChIKey of 5-(8-chloroquinolin-6-yl)-3-N-[(4-fluorophenyl)methyl]-6-phenylpyrazine-2,3-diamine?
The InChIKey is YDZMBTWBOSURMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H19ClFN5/c27-21-14-19(13-18-7-4-12-30-22(18)21)24-23(17-5-2-1-3-6-17)32-25(29)26(33-24)31-15-16-8-10-20(28)11-9-16/h1-14H,15H2,(H2,29,32)(H,31,33).
What are the key properties of 5-(8-chloroquinolin-6-yl)-3-N-[(4-fluorophenyl)methyl]-6-phenylpyrazine-2,3-diamine?
5-(8-chloroquinolin-6-yl)-3-N-[(4-fluorophenyl)methyl]-6-phenylpyrazine-2,3-diamine has a molecular weight of 455.92 g/mol, XLogP of 6.35, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(8-chloroquinolin-6-yl)-3-N-[(4-fluorophenyl)methyl]-6-phenylpyrazine-2,3-diamine is sourced from PubChem (CID 137430425), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).