About (1-methylpyrrol-3-yl) 3-amino-6-(8-chloroquinolin-6-yl)-5-phenylpyrazine-2-carboxylate
(1-methylpyrrol-3-yl) 3-amino-6-(8-chloroquinolin-6-yl)-5-phenylpyrazine-2-carboxylate (PubChem CID 137430547) has the molecular formula C25H18ClN5O2
and a molecular weight of 455.91 g/mol. Its IUPAC name is (1-methylpyrrol-3-yl) 3-amino-6-(8-chloroquinolin-6-yl)-5-phenylpyrazine-2-carboxylate.
Molecular Properties
| Compound Name | (1-methylpyrrol-3-yl) 3-amino-6-(8-chloroquinolin-6-yl)-5-phenylpyrazine-2-carboxylate |
| PubChem CID | 137430547 |
| Molecular Formula | C25H18ClN5O2 |
| Molecular Weight | 455.91 g/mol |
| Exact Mass | 455.11 |
| IUPAC Name | (1-methylpyrrol-3-yl) 3-amino-6-(8-chloroquinolin-6-yl)-5-phenylpyrazine-2-carboxylate |
| SMILES | Cn1ccc(OC(=O)c2nc(-c3cc(Cl)c4ncccc4c3)c(-c3ccccc3)nc2N)c1 |
| InChI | InChI=1S/C25H18ClN5O2/c1-31-11-9-18(14-31)33-25(32)23-24(27)30-21(15-6-3-2-4-7-15)22(29-23)17-12-16-8-5-10-28-20(16)19(26)13-17/h2-14H,1H3,(H2,27,30) |
| InChIKey | HOMGUSUFVRTVMB-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 95.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 455.91 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze (1-methylpyrrol-3-yl) 3-amino-6-(8-chloroquinolin-6-yl)-5-phenylpyrazine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-methylpyrrol-3-yl) 3-amino-6-(8-chloroquinolin-6-yl)-5-phenylpyrazine-2-carboxylate?
The IUPAC name of (1-methylpyrrol-3-yl) 3-amino-6-(8-chloroquinolin-6-yl)-5-phenylpyrazine-2-carboxylate (CID 137430547) is (1-methylpyrrol-3-yl) 3-amino-6-(8-chloroquinolin-6-yl)-5-phenylpyrazine-2-carboxylate.
What is the SMILES notation for (1-methylpyrrol-3-yl) 3-amino-6-(8-chloroquinolin-6-yl)-5-phenylpyrazine-2-carboxylate?
The canonical SMILES for (1-methylpyrrol-3-yl) 3-amino-6-(8-chloroquinolin-6-yl)-5-phenylpyrazine-2-carboxylate is Cn1ccc(OC(=O)c2nc(-c3cc(Cl)c4ncccc4c3)c(-c3ccccc3)nc2N)c1.
What is the InChIKey of (1-methylpyrrol-3-yl) 3-amino-6-(8-chloroquinolin-6-yl)-5-phenylpyrazine-2-carboxylate?
The InChIKey is HOMGUSUFVRTVMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H18ClN5O2/c1-31-11-9-18(14-31)33-25(32)23-24(27)30-21(15-6-3-2-4-7-15)22(29-23)17-12-16-8-5-10-28-20(16)19(26)13-17/h2-14H,1H3,(H2,27,30).
What are the key properties of (1-methylpyrrol-3-yl) 3-amino-6-(8-chloroquinolin-6-yl)-5-phenylpyrazine-2-carboxylate?
(1-methylpyrrol-3-yl) 3-amino-6-(8-chloroquinolin-6-yl)-5-phenylpyrazine-2-carboxylate has a molecular weight of 455.91 g/mol, XLogP of 5.15, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (1-methylpyrrol-3-yl) 3-amino-6-(8-chloroquinolin-6-yl)-5-phenylpyrazine-2-carboxylate is sourced from PubChem (CID 137430547), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).