C22H17ClN6S — CID 137430823
5-(7-chloro-1H-indazol-5-yl)-3-(1-methylpyrrol-3-yl)sulfanyl-6-phenylpyrazin-2-amine (PubChem CID 137430823) has the molecular formula C22H17ClN6S and a molecular weight of 432.94 g/mol. Its IUPAC name is 5-(7-chloro-1H-indazol-5-yl)-3-(1-methylpyrrol-3-yl)sulfanyl-6-phenylpyrazin-2-amine.
| Compound Name | 5-(7-chloro-1H-indazol-5-yl)-3-(1-methylpyrrol-3-yl)sulfanyl-6-phenylpyrazin-2-amine |
|---|---|
| PubChem CID | 137430823 |
| Molecular Formula | C22H17ClN6S |
| Molecular Weight | 432.94 g/mol |
| Exact Mass | 432.09 |
| IUPAC Name | 5-(7-chloro-1H-indazol-5-yl)-3-(1-methylpyrrol-3-yl)sulfanyl-6-phenylpyrazin-2-amine |
| SMILES | Cn1ccc(Sc2nc(-c3cc(Cl)c4[nH]ncc4c3)c(-c3ccccc3)nc2N)c1 |
| InChI | InChI=1S/C22H17ClN6S/c1-29-8-7-16(12-29)30-22-21(24)26-19(13-5-3-2-4-6-13)20(27-22)14-9-15-11-25-28-18(15)17(23)10-14/h2-12H,1H3,(H2,24,26)(H,25,28) |
| InChIKey | WEFYBBFJZJKUGS-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 85.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.94 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |