C18H12ClF3N6 — CID 137431195
5-(8-chloroquinolin-6-yl)-6-(1-methylpyrazol-3-yl)-3-(trifluoromethyl)pyrazin-2-amine (PubChem CID 137431195) has the molecular formula C18H12ClF3N6 and a molecular weight of 404.78 g/mol. Its IUPAC name is 5-(8-chloroquinolin-6-yl)-6-(1-methylpyrazol-3-yl)-3-(trifluoromethyl)pyrazin-2-amine.
| Compound Name | 5-(8-chloroquinolin-6-yl)-6-(1-methylpyrazol-3-yl)-3-(trifluoromethyl)pyrazin-2-amine |
|---|---|
| PubChem CID | 137431195 |
| Molecular Formula | C18H12ClF3N6 |
| Molecular Weight | 404.78 g/mol |
| Exact Mass | 404.08 |
| IUPAC Name | 5-(8-chloroquinolin-6-yl)-6-(1-methylpyrazol-3-yl)-3-(trifluoromethyl)pyrazin-2-amine |
| SMILES | Cn1ccc(-c2nc(N)c(C(F)(F)F)nc2-c2cc(Cl)c3ncccc3c2)n1 |
| InChI | InChI=1S/C18H12ClF3N6/c1-28-6-4-12(27-28)15-14(25-16(17(23)26-15)18(20,21)22)10-7-9-3-2-5-24-13(9)11(19)8-10/h2-8H,1H3,(H2,23,26) |
| InChIKey | HDZHPQNNWIOLRU-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 82.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.78 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |