C9H13ClFN — CID 137432143
(2Z,4E)-3-chloro-N-ethenyl-4-fluorohepta-2,4-dien-2-amine (PubChem CID 137432143) has the molecular formula C9H13ClFN and a molecular weight of 189.66 g/mol. Its IUPAC name is (2Z,4E)-3-chloro-N-ethenyl-4-fluorohepta-2,4-dien-2-amine.
| Compound Name | (2Z,4E)-3-chloro-N-ethenyl-4-fluorohepta-2,4-dien-2-amine |
|---|---|
| PubChem CID | 137432143 |
| Molecular Formula | C9H13ClFN |
| Molecular Weight | 189.66 g/mol |
| Exact Mass | 189.07 |
| IUPAC Name | (2Z,4E)-3-chloro-N-ethenyl-4-fluorohepta-2,4-dien-2-amine |
| SMILES | C=CN/C(C)=C(Cl)/C(F)=C\CC |
| InChI | InChI=1S/C9H13ClFN/c1-4-6-8(11)9(10)7(3)12-5-2/h5-6,12H,2,4H2,1,3H3/b8-6+,9-7- |
| InChIKey | KNDNKQGWVZRWHL-FFELTBSMSA-N |
| XLogP | 3.45 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.66 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|