C23H25F9O6 — CID 137432153
[2-(3,3,4,4,5,5,6,6,6-nonafluorohexoxy)-2-oxoethyl] 3-(2-methylprop-2-enoyloxy)adamantane-1-carboxylate (PubChem CID 137432153) has the molecular formula C23H25F9O6 and a molecular weight of 568.43 g/mol. Its IUPAC name is [2-(3,3,4,4,5,5,6,6,6-nonafluorohexoxy)-2-oxoethyl] 3-(2-methylprop-2-enoyloxy)adamantane-1-carboxylate.
| Compound Name | [2-(3,3,4,4,5,5,6,6,6-nonafluorohexoxy)-2-oxoethyl] 3-(2-methylprop-2-enoyloxy)adamantane-1-carboxylate |
|---|---|
| PubChem CID | 137432153 |
| Molecular Formula | C23H25F9O6 |
| Molecular Weight | 568.43 g/mol |
| Exact Mass | 568.15 |
| IUPAC Name | [2-(3,3,4,4,5,5,6,6,6-nonafluorohexoxy)-2-oxoethyl] 3-(2-methylprop-2-enoyloxy)adamantane-1-carboxylate |
| SMILES | C=C(C)C(=O)OC12CC3CC(C1)CC(C(=O)OCC(=O)OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)(C3)C2 |
| InChI | InChI=1S/C23H25F9O6/c1-12(2)16(34)38-19-8-13-5-14(9-19)7-18(6-13,11-19)17(35)37-10-15(33)36-4-3-20(24,25)21(26,27)22(28,29)23(30,31)32/h13-14H,1,3-11H2,2H3 |
| InChIKey | HVTFMXSRLPGVMV-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.43 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|