C22H25F7O6 — CID 137432155
3,3,4,4,5,5,5-heptafluoropentyl 3-[2-(2-methylprop-2-enoyloxy)acetyl]oxyadamantane-1-carboxylate (PubChem CID 137432155) has the molecular formula C22H25F7O6 and a molecular weight of 518.42 g/mol. Its IUPAC name is 3,3,4,4,5,5,5-heptafluoropentyl 3-[2-(2-methylprop-2-enoyloxy)acetyl]oxyadamantane-1-carboxylate.
| Compound Name | 3,3,4,4,5,5,5-heptafluoropentyl 3-[2-(2-methylprop-2-enoyloxy)acetyl]oxyadamantane-1-carboxylate |
|---|---|
| PubChem CID | 137432155 |
| Molecular Formula | C22H25F7O6 |
| Molecular Weight | 518.42 g/mol |
| Exact Mass | 518.15 |
| IUPAC Name | 3,3,4,4,5,5,5-heptafluoropentyl 3-[2-(2-methylprop-2-enoyloxy)acetyl]oxyadamantane-1-carboxylate |
| SMILES | C=C(C)C(=O)OCC(=O)OC12CC3CC(C1)CC(C(=O)OCCC(F)(F)C(F)(F)C(F)(F)F)(C3)C2 |
| InChI | InChI=1S/C22H25F7O6/c1-12(2)16(31)34-10-15(30)35-19-8-13-5-14(9-19)7-18(6-13,11-19)17(32)33-4-3-20(23,24)21(25,26)22(27,28)29/h13-14H,1,3-11H2,2H3 |
| InChIKey | GXXMEUKXQDGYFP-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.42 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|