C16H19F7O4 — CID 137432157
3,3,4,4,5,5,5-heptafluoropentyl 4-(2-methylprop-2-enoyloxy)cyclohexane-1-carboxylate (PubChem CID 137432157) has the molecular formula C16H19F7O4 and a molecular weight of 408.31 g/mol. Its IUPAC name is 3,3,4,4,5,5,5-heptafluoropentyl 4-(2-methylprop-2-enoyloxy)cyclohexane-1-carboxylate.
| Compound Name | 3,3,4,4,5,5,5-heptafluoropentyl 4-(2-methylprop-2-enoyloxy)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 137432157 |
| Molecular Formula | C16H19F7O4 |
| Molecular Weight | 408.31 g/mol |
| Exact Mass | 408.12 |
| IUPAC Name | 3,3,4,4,5,5,5-heptafluoropentyl 4-(2-methylprop-2-enoyloxy)cyclohexane-1-carboxylate |
| SMILES | C=C(C)C(=O)OC1CCC(C(=O)OCCC(F)(F)C(F)(F)C(F)(F)F)CC1 |
| InChI | InChI=1S/C16H19F7O4/c1-9(2)12(24)27-11-5-3-10(4-6-11)13(25)26-8-7-14(17,18)15(19,20)16(21,22)23/h10-11H,1,3-8H2,2H3 |
| InChIKey | GMDBVZJOUKZSNV-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.31 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|