C20H22F6O6 — CID 137432339
[2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-2-oxoethyl] 3-(2-methylprop-2-enoyloxy)adamantane-1-carboxylate (PubChem CID 137432339) has the molecular formula C20H22F6O6 and a molecular weight of 472.38 g/mol. Its IUPAC name is [2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-2-oxoethyl] 3-(2-methylprop-2-enoyloxy)adamantane-1-carboxylate.
| Compound Name | [2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-2-oxoethyl] 3-(2-methylprop-2-enoyloxy)adamantane-1-carboxylate |
|---|---|
| PubChem CID | 137432339 |
| Molecular Formula | C20H22F6O6 |
| Molecular Weight | 472.38 g/mol |
| Exact Mass | 472.13 |
| IUPAC Name | [2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-2-oxoethyl] 3-(2-methylprop-2-enoyloxy)adamantane-1-carboxylate |
| SMILES | C=C(C)C(=O)OC12CC3CC(C1)CC(C(=O)OCC(=O)OC(C(F)(F)F)C(F)(F)F)(C3)C2 |
| InChI | InChI=1S/C20H22F6O6/c1-10(2)14(28)32-18-6-11-3-12(7-18)5-17(4-11,9-18)16(29)30-8-13(27)31-15(19(21,22)23)20(24,25)26/h11-12,15H,1,3-9H2,2H3 |
| InChIKey | QKEVSTSMJHNSDR-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.38 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|