C17H19F9O4 — CID 137432370
3,3,4,4,5,5,6,6,6-nonafluorohexyl 4-(2-methylprop-2-enoyloxy)cyclohexane-1-carboxylate (PubChem CID 137432370) has the molecular formula C17H19F9O4 and a molecular weight of 458.32 g/mol. Its IUPAC name is 3,3,4,4,5,5,6,6,6-nonafluorohexyl 4-(2-methylprop-2-enoyloxy)cyclohexane-1-carboxylate.
| Compound Name | 3,3,4,4,5,5,6,6,6-nonafluorohexyl 4-(2-methylprop-2-enoyloxy)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 137432370 |
| Molecular Formula | C17H19F9O4 |
| Molecular Weight | 458.32 g/mol |
| Exact Mass | 458.11 |
| IUPAC Name | 3,3,4,4,5,5,6,6,6-nonafluorohexyl 4-(2-methylprop-2-enoyloxy)cyclohexane-1-carboxylate |
| SMILES | C=C(C)C(=O)OC1CCC(C(=O)OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)CC1 |
| InChI | InChI=1S/C17H19F9O4/c1-9(2)12(27)30-11-5-3-10(4-6-11)13(28)29-8-7-14(18,19)15(20,21)16(22,23)17(24,25)26/h10-11H,1,3-8H2,2H3 |
| InChIKey | ISMHGUADLRTARS-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.32 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|